CymitQuimica logo

CAS 51535-01-4

:

Pyrrolidine, 3-(chloromethyl)-1-(phenylmethyl)-

Description:
Pyrrolidine, 3-(chloromethyl)-1-(phenylmethyl)-, with the CAS number 51535-01-4, is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered saturated nitrogen-containing heterocycle. This compound features a chloromethyl group and a phenylmethyl group attached to the pyrrolidine ring, contributing to its unique reactivity and potential applications. The presence of the chloromethyl group makes it a suitable candidate for nucleophilic substitution reactions, while the phenylmethyl group can enhance its lipophilicity and influence its interaction with biological systems. Pyrrolidine derivatives are often studied for their pharmacological properties, including potential use in medicinal chemistry. The compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Safety data should be consulted for handling, as it may pose health risks, including irritation or toxicity. Overall, this compound's structural features suggest it could be of interest in various chemical and pharmaceutical research applications.
Formula:C12H16ClN
InChI:InChI=1S/C12H16ClN/c13-8-12-6-7-14(10-12)9-11-4-2-1-3-5-11/h1-5,12H,6-10H2
InChI key:QWGYCLIMHHUXSL-UHFFFAOYSA-N
SMILES:C1CN(CC1CCl)CC2=CC=CC=C2
Found 2 products.