CymitQuimica logo

CAS 51546-08-8

:

2-(5-amino-3-methyl-1H-pyrazol-1-yl)ethanol

Description:
2-(5-amino-3-methyl-1H-pyrazol-1-yl)ethanol, with the CAS number 51546-08-8, is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features an amino group and a hydroxyl group, contributing to its potential as a versatile building block in medicinal chemistry and organic synthesis. The presence of the amino group suggests it may participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions. The hydroxyl group enhances its solubility in polar solvents, making it suitable for biological applications. Additionally, the methyl group on the pyrazole ring can influence its electronic properties and steric hindrance, affecting its reactivity and interactions with biological targets. Overall, this compound's unique structure and functional groups make it of interest in the development of pharmaceuticals and agrochemicals, where it may exhibit specific biological activities or serve as a precursor for further chemical modifications.
Formula:C6H11N3O
InChI:InChI=1/C6H11N3O/c1-5-4-6(7)9(8-5)2-3-10/h4,10H,2-3,7H2,1H3
InChI key:ANQYOZSPKNDFPD-UHFFFAOYSA-N
SMILES:Cc1cc(N)n(CCO)n1
Synonyms:
  • 1H-pyrazole-1-ethanol, 5-amino-3-methyl-
  • 2-(5-Amino-3-methyl-1H-pyrazol-1-yl)ethanol
Found 4 products.