CymitQuimica logo

CAS 51549-37-2

:

Cytidine, N-benzoyl-2'-deoxy-3'-O-[(1,1-dimethylethyl)dimethylsilyl]-

Description:
Cytidine, N-benzoyl-2'-deoxy-3'-O-[(1,1-dimethylethyl)dimethylsilyl]- is a modified nucleoside derivative that features a benzoyl group and a silyl protecting group. This compound is characterized by its structural components, which include a cytidine base, a deoxyribose sugar, and a silyl ether moiety that enhances its stability and solubility in organic solvents. The presence of the benzoyl group typically indicates that the compound may be used in various biochemical applications, such as in the synthesis of nucleotides or as a building block in oligonucleotide synthesis. The silyl group serves to protect the hydroxyl group at the 3' position, making it less reactive during chemical reactions. This compound is often utilized in research and development within the fields of molecular biology and medicinal chemistry, particularly in the study of nucleic acid structures and functions. Its unique modifications allow for increased versatility in synthetic pathways and potential applications in drug development.
Formula:C22H31N3O5Si
InChI:InChI=1S/C22H31N3O5Si/c1-22(2,3)31(4,5)30-16-13-19(29-17(16)14-26)25-12-11-18(24-21(25)28)23-20(27)15-9-7-6-8-10-15/h6-12,16-17,19,26H,13-14H2,1-5H3,(H,23,24,27,28)/t16-,17+,19+/m0/s1
InChI key:XZESDHQEKGJAIW-YQVWRLOYSA-N
SMILES:CC(C)(C)[Si](C)(C)O[C@H]1C[C@@H](O[C@@H]1CO)N2C=CC(=NC2=O)NC(=O)C3=CC=CC=C3
Found 2 products.