CymitQuimica logo

CAS 51549-39-4

:

Adenosine,N-benzoyl-2'-deoxy-5'-O-[(1,1-dimethylethyl)dimethylsilyl]-

Description:
Adenosine, N-benzoyl-2'-deoxy-5'-O-[(1,1-dimethylethyl)dimethylsilyl]- is a modified nucleoside derivative of adenosine, characterized by the presence of a benzoyl group and a silyl protecting group. This compound features a deoxyribose sugar, which distinguishes it from ribonucleosides. The silyl group enhances the compound's stability and solubility, making it useful in various synthetic applications, particularly in the field of nucleic acid chemistry. The benzoyl moiety can serve as a protective group, facilitating further chemical modifications or reactions. The presence of these functional groups contributes to the compound's unique reactivity and properties, allowing it to participate in biochemical processes or serve as a precursor in the synthesis of more complex molecules. Additionally, the compound's structure suggests potential applications in medicinal chemistry, particularly in the development of antiviral or anticancer agents, due to the biological significance of adenosine derivatives. Overall, this compound exemplifies the intricate relationship between structure and function in nucleoside chemistry.
Formula:C23H31N5O4Si
InChI:InChI=1S/C23H31N5O4Si/c1-23(2,3)33(4,5)31-12-17-16(29)11-18(32-17)28-14-26-19-20(24-13-25-21(19)28)27-22(30)15-9-7-6-8-10-15/h6-10,13-14,16-18,29H,11-12H2,1-5H3,(H,24,25,27,30)/t16-,17+,18+/m0/s1
InChI key:BJZZQJFYKQPUGO-RCCFBDPRSA-N
SMILES:CC(C)(C)[Si](C)(C)OC[C@@H]1[C@H](C[C@@H](O1)N2C=NC3=C(N=CN=C32)NC(=O)C4=CC=CC=C4)O
Synonyms:
  • N6-Benzoyl-5'-tert-butyldimethylsilyl-2'-deoxyadenosine
Found 7 products.