CymitQuimica logo

CAS 51549-40-7

:

N-Benzoyl-2′-deoxy-3′-O-[(1,1-dimethylethyl)dimethylsilyl]adenosine

Description:
N-Benzoyl-2′-deoxy-3′-O-[(1,1-dimethylethyl)dimethylsilyl]adenosine is a modified nucleoside that features a benzoyl group and a silyl protecting group, which enhances its stability and solubility. This compound is characterized by its structural components, including the adenosine base, a deoxyribose sugar, and the presence of a dimethylsilyl group that provides steric hindrance and protects the hydroxyl group at the 3′ position. The benzoyl group at the 2′ position contributes to the compound's lipophilicity, potentially influencing its interaction with biological membranes and enzymes. The presence of the silyl group also allows for selective reactions in synthetic chemistry, making it useful in various biochemical applications. This compound is typically utilized in nucleic acid chemistry and molecular biology for the synthesis of modified oligonucleotides, where its unique properties can facilitate specific interactions or enhance stability against nucleases. Overall, N-Benzoyl-2′-deoxy-3′-O-[(1,1-dimethylethyl)dimethylsilyl]adenosine serves as a valuable tool in the study and manipulation of nucleic acids.
Formula:C23H31N5O4Si
InChI:InChI=1S/C23H31N5O4Si/c1-23(2,3)33(4,5)32-16-11-18(31-17(16)12-29)28-14-26-19-20(24-13-25-21(19)28)27-22(30)15-9-7-6-8-10-15/h6-10,13-14,16-18,29H,11-12H2,1-5H3,(H,24,25,27,30)/t16-,17+,18+/m0/s1
InChI key:InChIKey=JGELYOCTJSVMRL-RCCFBDPRSA-N
SMILES:N(C(=O)C1=CC=CC=C1)C2=C3C(N(C=N3)[C@H]4C[C@H](O[Si](C(C)(C)C)(C)C)[C@@H](CO)O4)=NC=N2
Synonyms:
  • Adenosine, N-benzoyl-2′-deoxy-3′-O-[(1,1-dimethylethyl)dimethylsilyl]-
  • N-Benzoyl-2′-deoxy-3′-O-[(1,1-dimethylethyl)dimethylsilyl]adenosine
Found 6 products.