CAS 51557-26-7
:3-(2-Naphthyl)acrylic acid
Description:
3-(2-Naphthyl)acrylic acid, with the CAS number 51557-26-7, is an organic compound characterized by its structure, which features a naphthalene ring attached to an acrylic acid moiety. This compound typically appears as a solid at room temperature and is known for its aromatic properties due to the presence of the naphthyl group. It exhibits both acidic and unsaturated characteristics, making it a useful building block in organic synthesis and materials science. The compound is soluble in organic solvents, such as ethanol and acetone, but has limited solubility in water. Its reactivity is influenced by the double bond in the acrylic acid portion, allowing for various chemical transformations, including polymerization and esterification. Additionally, 3-(2-Naphthyl)acrylic acid may exhibit biological activity, which has led to interest in its potential applications in pharmaceuticals and agrochemicals. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C13H10O
InChI:InChI=1/C13H10O/c14-9-3-4-11-7-8-12-5-1-2-6-13(12)10-11/h1-10H/b4-3+
Synonyms:- 2-Naphthylacrylic acid
- 2-(Naphthalen-1-Yl)Prop-2-Enoic Acid
- (2Z)-3-(naphthalen-2-yl)prop-2-enoate
- (2Z)-3-(naphthalen-2-yl)prop-2-enoic acid
- (2E)-3-naphthalen-2-ylprop-2-enal
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-(Naphth-2-yl)acrylic acid
CAS:3-(Naphth-2-yl)acrylic acidFormula:C13H10O2Purity:98%Color and Shape:Solid-PowderMolecular weight:198.21733-(Naphthalen-2-yl)acrylic acid
CAS:Formula:C13H10O2Purity:97%Color and Shape:SolidMolecular weight:198.21733-(Naphthalen-2-yl)acrylic acid
CAS:3-(Naphthalen-2-yl)acrylic acidFormula:C13H10O2Purity:98% (E)Molecular weight:198.223-(2-Naphthyl)acrylic acid
CAS:3-(2-Naphthyl)acrylic acid is a compound that inhibits the enzymatic activity of benzylpiperidine N-acetyltransferase, which is an enzyme that catalyzes the conversion of benzylamine to benzylpiperidine. This inhibition prevents the production of dopamine and norepinephrine, with a consequent neuroprotective effect. 3-(2-Naphthyl)acrylic acid has been shown to be effective in reducing oxidative stress in intestinal fluids, thereby protecting against the damaging effects of free radicals. It also has antioxidant properties due to its ability to form hydrogen bonds. 3-(2-Naphthyl)acrylic acid can also be used as a cross-coupling agent in organic synthesis, due to its functional groups.Formula:C13H10O2Purity:Min. 95%Molecular weight:198.22 g/mol




