CymitQuimica logo

CAS 51600-25-0

:

(R)-2-methyl-1-phenylpropan-1-amine hydrochloride

Description:
(R)-2-methyl-1-phenylpropan-1-amine hydrochloride, also known as (R)-methamphetamine hydrochloride, is a chiral amine with stimulant properties. It is characterized by its molecular structure, which includes a phenyl group and a branched alkyl chain, contributing to its pharmacological activity. The hydrochloride salt form enhances its solubility in water, making it suitable for various applications, including research and potential therapeutic uses. As a stimulant, it primarily affects the central nervous system, increasing the release of neurotransmitters such as dopamine and norepinephrine. This compound is regulated due to its potential for abuse and addiction, and it is classified under controlled substances in many jurisdictions. Its stereochemistry is significant, as the (R)-enantiomer is typically more potent than the (S)-enantiomer in terms of stimulant effects. Safety and handling precautions are essential when working with this substance, given its psychoactive properties and associated health risks.
Formula:C10H16ClN
InChI:InChI=1S/C10H15N.ClH/c1-8(2)10(11)9-6-4-3-5-7-9;/h3-8,10H,11H2,1-2H3;1H/t10-;/m1./s1
InChI key:LZDSYIZUCSUNKJ-HNCPQSOCSA-N
SMILES:CC(C)[C@H](C1=CC=CC=C1)N.Cl
Found 4 products.