CymitQuimica logo

CAS 51626-47-2

:

3-(2-nitro-1-phenylethyl)-1H-indole

Description:
3-(2-Nitro-1-phenylethyl)-1H-indole, with the CAS number 51626-47-2, is a chemical compound that features a complex structure combining an indole moiety with a nitro-substituted phenylethyl group. Indole is a bicyclic structure consisting of a benzene ring fused to a pyrrole ring, which contributes to the compound's aromatic properties and potential biological activity. The presence of the nitro group introduces electron-withdrawing characteristics, which can influence the compound's reactivity and solubility. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry and drug development. Its synthesis typically involves multi-step organic reactions, and it may be characterized using techniques such as NMR spectroscopy, mass spectrometry, and infrared spectroscopy to confirm its structure and purity. As with many organic compounds, safety precautions should be taken when handling it, as nitro compounds can be sensitive and potentially hazardous. Overall, 3-(2-nitro-1-phenylethyl)-1H-indole represents a unique structure that may have applications in various fields, including pharmaceuticals and materials science.
Formula:C16H14N2O2
InChI:InChI=1/C16H14N2O2/c19-18(20)11-15(12-6-2-1-3-7-12)14-10-17-16-9-5-4-8-13(14)16/h1-10,15,17H,11H2
SMILES:c1ccc(cc1)C(CN(=O)=O)c1c[nH]c2ccccc12
Synonyms:
  • 1H-indole, 3-(2-nitro-1-phenylethyl)-
  • 3-(2-Nitro-1-phenyl-ethyl)-1H-indole
Found 1 products.