CymitQuimica logo

CAS 516481-68-8

:

5,6-Diamino-2-pyridinecarbonitrile

Description:
5,6-Diamino-2-pyridinecarbonitrile is an organic compound characterized by its pyridine ring structure, which features two amino groups (-NH2) and a cyano group (-C≡N) attached to the carbon atom of the pyridine. This compound is typically a solid at room temperature and is soluble in polar solvents due to the presence of the amino groups, which can engage in hydrogen bonding. The presence of the cyano group contributes to its reactivity, making it a potential intermediate in organic synthesis and pharmaceuticals. The amino groups can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Its molecular structure allows for potential interactions with biological targets, which could be explored for therapeutic applications. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.
Formula:C6H6N4
InChI:InChI=1S/C6H6N4/c7-3-4-1-2-5(8)6(9)10-4/h1-2H,8H2,(H2,9,10)
InChI key:InChIKey=QGGRYBBNOBLWNQ-UHFFFAOYSA-N
SMILES:C(#N)C=1N=C(N)C(N)=CC1
Synonyms:
  • 5,6-Diamino-2-pyridinecarbonitrile
  • 5,6-Diaminopyridine-2-carbonitrile
  • 2-Pyridinecarbonitrile, 5,6-diamino-
Found 3 products.