CAS 51686-78-3

2,4-Dibromonitrobenzene

Description:

2,4-Dibromonitrobenzene is an aromatic compound characterized by the presence of two bromine atoms and one nitro group attached to a benzene ring. Its molecular formula is C6H3Br2N O2, indicating a structure that includes six carbon atoms, three hydrogen atoms, two bromine atoms, one nitrogen atom, and two oxygen atoms. This compound typically appears as a yellow crystalline solid and is known for its moderate solubility in organic solvents, such as ethanol and acetone, while being less soluble in water. 2,4-Dibromonitrobenzene is primarily used in organic synthesis and as an intermediate in the production of dyes, pharmaceuticals, and agrochemicals. It exhibits properties such as being a potential mutagen and having environmental persistence, which necessitates careful handling and disposal. Additionally, it can undergo various chemical reactions, including nucleophilic substitution and reduction, making it a versatile compound in synthetic organic chemistry. Safety precautions should be taken when working with this substance due to its toxicological profile.

Formula: C₆H₃Br₂NO₂

InChI: InChI=1/C6H3Br2NO2/c7-4-1-2-6(9(10)11)5(8)3-4/h1-3H

SMILES: c1cc(c(cc1Br)Br)N(=O)=O

Synonyms:

• 2,4-Dibromo-1-nitrobenzene
• 2,4-Dibromo-1-nitro-benzene

2,4-Dibromo-1-nitrobenzene

CAS: 51686-78-3

Formula: C₆H₃Br₂NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 280.9015

Ref: IN-DA003FPV

2,4-Dibromo-1-nitrobenzene

CAS: 51686-78-3

2,4-Dibromo-1-nitrobenzene

Purity: 98%

Molecular weight: 280.90g/mol

Ref: 54-OR79367

2,4-Dibromo-1-nitrobenzene

CAS: 51686-78-3

Formula: C₆H₃Br₂NO₂

Purity: >98.0%(GC)

Color and Shape: White to Yellow to Green powder to crystal

Molecular weight: 280.90

Ref: 3B-D4790

2,4-Dibromo-1-nitrobenzene

CAS: 51686-78-3

Formula: C₆H₃Br₂NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 280.903

Ref: 10-F217055