CymitQuimica logo

CAS 51686-78-3

:

2,4-Dibromonitrobenzene

Description:
2,4-Dibromonitrobenzene is an aromatic compound characterized by the presence of two bromine atoms and one nitro group attached to a benzene ring. Its molecular formula is C6H3Br2N O2, indicating a structure that includes six carbon atoms, three hydrogen atoms, two bromine atoms, one nitrogen atom, and two oxygen atoms. This compound typically appears as a yellow crystalline solid and is known for its moderate solubility in organic solvents, such as ethanol and acetone, while being less soluble in water. 2,4-Dibromonitrobenzene is primarily used in organic synthesis and as an intermediate in the production of dyes, pharmaceuticals, and agrochemicals. It exhibits properties such as being a potential mutagen and having environmental persistence, which necessitates careful handling and disposal. Additionally, it can undergo various chemical reactions, including nucleophilic substitution and reduction, making it a versatile compound in synthetic organic chemistry. Safety precautions should be taken when working with this substance due to its toxicological profile.
Formula:C6H3Br2NO2
InChI:InChI=1/C6H3Br2NO2/c7-4-1-2-6(9(10)11)5(8)3-4/h1-3H
InChI key:DXRVYZGVVFZCFP-UHFFFAOYSA-N
SMILES:c1cc(c(cc1Br)Br)N(=O)=O
Synonyms:
  • 2,4-Dibromo-1-nitrobenzene
  • 2,4-Dibromo-1-nitro-benzene
Found 5 products.