CAS 517-44-2
:Sennidin B
Description:
Sennidin B, with the CAS number 517-44-2, is a natural compound classified as a glycoside, specifically a type of anthraquinone glycoside. It is primarily derived from the Senna plant, which is known for its use as a laxative. The compound exhibits a yellowish-brown color and is typically found in the form of a crystalline solid. Sennidin B is notable for its pharmacological properties, particularly its ability to stimulate bowel movements by promoting peristalsis in the intestines. Its mechanism of action involves the hydrolysis of the glycosidic bond, releasing the active aglycone, which exerts a laxative effect. Additionally, Sennidin B may possess antioxidant properties, contributing to its potential health benefits. The compound is soluble in water and alcohol, making it suitable for various formulations in herbal medicine. As with many natural products, the safety and efficacy of Sennidin B depend on dosage and individual health conditions, necessitating careful consideration in its use.
Formula:C30H18O10
InChI:InChI=1/C30H18O10/c31-17-5-1-3-13-21(15-7-11(29(37)38)9-19(33)25(15)27(35)23(13)17)22-14-4-2-6-18(32)24(14)28(36)26-16(22)8-12(30(39)40)10-20(26)34/h1-10,21-22,31-34H,(H,37,38)(H,39,40)/t21-,22+
InChI key:InChIKey=JPMRHWLJLNKRTJ-SZPZYZBQNA-N
SMILES:O=C1C=2C([C@@](C=3C1=C(O)C=CC3)([C@@]4(C=5C(C(=O)C=6C4=CC=CC6O)=C(O)C=C(C(O)=O)C5)[H])[H])=CC(C(O)=O)=CC2O
Synonyms:- (9,9'-Bianthracene)-2,2'-dicarboxylic acid, 9,9',10,10'-tetrahydro-4,4',5,5'-tetrahydroxy-10,10'-dioxo-, (R*,S*)-
- 4,4',5,5'-Tetrahydroxy-10,10'-Dioxo-9,9',10,10'-Tetrahydro-9,9'-Bianthracene-2,2'-Dicarboxylic Acid
- 9-[(9R)-2-carboxy-4,5-dihydroxy-10-oxo-9H-anthracen-9-yl]-4,5-dihydroxy-10-oxo-9H-anthracene-2-carboxylic acid
- Nsc 658576
- Sennidin B
- Sennidine B
- [9,9′-Bianthracene]-2,2′-dicarboxylic acid, 9,9′,10,10′-tetrahydro-4,4′,5,5′-tetrahydroxy-10,10′-dioxo-, (9R,9′S)-rel-
- [9,9′-Bianthracene]-2,2′-dicarboxylic acid, 9,9′,10,10′-tetrahydro-4,4′,5,5′-tetrahydroxy-10,10′-dioxo-, (R*,S*)-
- [9,9′-Bianthracene]-2,2′-dicarboxylic acid, 9,9′,10,10′-tetrahydro-4,4′,5,5′-tetrahydroxy-10,10′-dioxo-, meso-
- rel-(9R,9′S)-9,9′,10,10′-Tetrahydro-4,4′,5,5′-tetrahydroxy-10,10′-dioxo[9,9′-bianthracene]-2,2′-dicarboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
Sennidine B
CAS:Sennidine B analytical standard provided with chromatographic purity, to be used as reference material for qualitative determination.Formula:C30H18O10Purity:(HPLC) ≥90%Color and Shape:PowderMolecular weight:538.46rel-(9R,9′S)-9,9′,10,10′-Tetrahydro-4,4′,5,5′-tetrahydroxy-10,10′-dioxo[9,9′-bianthracene]-2,2′-dicarboxylic acid
CAS:rel-(9R,9′S)-9,9′,10,10′-Tetrahydro-4,4′,5,5′-tetrahydroxy-10,10′-dioxo[9,9′-bianthracene]-2,2′-dicarboxylic acidFormula:C30H18O10Purity:98%Molecular weight:538.46Sennidin B
CAS:Sennidin B stimulates glucose incorporation in rat adipocytes.Formula:C30H18O10Purity:95%~99%Molecular weight:538.464Sennidin B
CAS:rel-(9R,9′S)-9,9′,10,10′-Tetrahydro-4,4′,5,5′-tetrahydroxy-10,10′-dioxo[9,9′-bianthracene]-2,2′-dicarboxylic acidFormula:C30H18O10Purity:98%Molecular weight:538.46Sennidine B
CAS:Sennidine B is a natural anthraquinone compound, which is derived from the plant species of the genus Senna. This compound functions primarily by promoting peristalsis in the colon, thus facilitating bowel movements. Sennidine B achieves this by modulating ion transport in the intestinal epithelium, enhancing water and electrolyte secretion, and stimulating the colonic muscles.
Purity:Min. 95%Molecular weight:538.46 g/mol









