CAS 517-73-7
:Melicopicine
Description:
Melicopicine, with the CAS number 517-73-7, is an alkaloid derived from the plant Melicope species, particularly known for its presence in certain tropical plants. This compound exhibits a complex structure typical of many alkaloids, often characterized by a bicyclic framework. Melicopicine is recognized for its potential biological activities, including antimicrobial and anti-inflammatory properties, which have garnered interest in pharmacological research. The substance is typically found in a crystalline form and is soluble in organic solvents, reflecting its hydrophobic nature. Its chemical behavior is influenced by the presence of nitrogen atoms in its structure, which can participate in various chemical reactions. As with many alkaloids, melicopicine may also exhibit a range of effects on biological systems, making it a subject of study for its therapeutic potential. However, detailed studies on its pharmacokinetics and toxicity are essential for understanding its safety and efficacy in medicinal applications.
Formula:C18H19NO5
InChI:InChI=1/C18H19NO5/c1-19-11-9-7-6-8-10(11)14(20)12-13(19)16(22-3)18(24-5)17(23-4)15(12)21-2/h6-9H,1-5H3
InChI key:InChIKey=URPVDDXMEZAEJY-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(=C(OC)C(OC)=C1OC)N(C)C=3C(C2=O)=CC=CC3
Synonyms:- 1,2,3,4-Tetramethoxy-10-methyl-9(10H)-acridinone
- 1,2,3,4-Tetramethoxy-10-methylacridin-9-one
- 9(10H)-Acridinone, 1,2,3,4-tetramethoxy-10-methyl-
- 9-Acridanone, 1,2,3,4-tetramethoxy-10-methyl-
- Acridin-9(10H)-one, 10-methyl-1,2,3,4-tetramethoxy-
- Melicopicine
- NSC 402921
- 1,2,3,4-Tetramethoxy-10-methylacridin-9(10H)-one
- 1,2,3,4-Tetramethoxy-10-methyl-9,10-dihydroacridine-9-one
- 1,2,3,4-tetramethoxy-10-methyl-acridin-9-one
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Melicopicene
CAS:Melicopicene is a bioactive compound, specifically a natural substance, which is derived from the secretions or metabolic processes of honeybees. This compound exhibits potent antimicrobial properties, acting primarily by disrupting microbial cell walls and interfering with essential enzymatic processes within pathogenic microorganisms. Its mode of action is characterized by the ability to inhibit the growth and proliferation of various bacterial and fungal species effectively.Formula:C18H19NO5Purity:Min. 95%Molecular weight:329.35 g/molMelicopicine
CAS:Melicopicine is a useful organic compound for research related to life sciences. The catalog number is T124734 and the CAS number is 517-73-7.Formula:C18H19NO5Color and Shape:SolidMolecular weight:329.352

