CymitQuimica logo

CAS 51792-85-9

:

1,4-Dibenzyloxy-2-nitrobenzene

Description:
1,4-Dibenzyloxy-2-nitrobenzene is an organic compound characterized by its nitro and ether functional groups. It features a benzene ring substituted at the 1 and 4 positions with benzyloxy groups and at the 2 position with a nitro group. This compound typically appears as a solid at room temperature and is known for its relatively low solubility in water, while being more soluble in organic solvents such as ethanol and dichloromethane. The presence of the nitro group contributes to its electron-withdrawing properties, which can influence its reactivity and potential applications in organic synthesis and materials science. Additionally, the benzyloxy substituents can enhance the compound's stability and alter its electronic properties, making it of interest in various chemical reactions, including nucleophilic substitutions and coupling reactions. Safety precautions should be taken when handling this compound, as nitro compounds can be hazardous and may pose environmental risks.
Formula:C20H17NO4
InChI:InChI=1/C20H17NO4/c22-21(23)19-13-18(24-14-16-7-3-1-4-8-16)11-12-20(19)25-15-17-9-5-2-6-10-17/h1-13H,14-15H2
InChI key:QDZFMSSFDIBXED-UHFFFAOYSA-N
SMILES:c1ccc(cc1)COc1ccc(c(c1)N(=O)=O)OCc1ccccc1
Synonyms:
  • Nitrohydroquinone dibenzyl ether
  • 1,4-Bis(Benzyloxy)-2-Nitrobenzene
Found 4 products.