CAS 51833-78-4: angiotensin fragment 1-7 human acetate
Description:Angiotensin fragment 1-7, also known as angiotensin 1-7 or A-1-7, is a peptide that plays a crucial role in the renin-angiotensin system, which regulates blood pressure and fluid balance. This fragment is derived from the cleavage of angiotensin II and is known for its vasodilatory effects, promoting cardiovascular health by counteracting the actions of angiotensin II. The acetate form indicates that the peptide is in a salt form, which can enhance its stability and solubility. Characteristically, angiotensin 1-7 exhibits biological activity through its interaction with the Mas receptor, leading to various physiological effects, including anti-inflammatory and anti-fibrotic actions. It is often studied for its potential therapeutic applications in conditions such as hypertension, heart failure, and kidney disease. The CAS number 51833-78-4 uniquely identifies this specific peptide, facilitating its recognition in scientific literature and databases. Overall, angiotensin fragment 1-7 is a significant biomolecule with implications in cardiovascular physiology and potential clinical applications.
Formula:C41H62N12O11
InChI:InChI=1/C41H62N12O11/c1-5-22(4)33(38(61)50-29(17-24-19-45-20-47-24)39(62)53-15-7-9-30(53)40(63)64)52-36(59)28(16-23-10-12-25(54)13-11-23)49-37(60)32(21(2)3)51-35(58)27(8-6-14-46-41(43)44)48-34(57)26(42)18-31(55)56/h10-13,19-22,26-30,32-33,54H,5-9,14-18,42H2,1-4H3,(H,45,47)(H,48,57)(H,49,60)(H,50,61)(H,51,58)(H,52,59)(H,55,56)(H,63,64)(H4,43,44,46)/t22-,26-,27-,28-,29-,30-,32-,33-/m0/s1
- Synonyms:
- Angiotensin I/II (1-7)
- H-Asp-Arg-Val-Tyr-Ile-His-Pro-OH
- L-alpha-aspartyl-N~5~-(diaminomethylidene)-L-ornithyl-L-valyl-L-tyrosyl-L-isoleucyl-L-histidyl-L-proline