CAS 519-23-3
:Ellipticine
Description:
Ellipticine is a naturally occurring alkaloid derived from the leaves of the plant genus Ochrosia, known for its potential anticancer properties. It has a complex polycyclic structure, characterized by a fused indole and quinoline system, which contributes to its biological activity. Ellipticine exhibits a range of pharmacological effects, primarily as an antitumor agent, by intercalating into DNA and inhibiting topoisomerase II, thereby disrupting DNA replication and transcription. This compound is typically found as a pale yellow to orange crystalline solid and is sparingly soluble in water but more soluble in organic solvents. Its chemical formula is C15H13N, and it has a molecular weight of approximately 223.27 g/mol. In addition to its anticancer properties, ellipticine has shown potential in treating other conditions, including viral infections. However, its use is often limited by toxicity and side effects, necessitating further research to optimize its therapeutic applications and minimize adverse effects.
Formula:C17H14N2
InChI:InChI=1S/C17H14N2/c1-10-14-9-18-8-7-12(14)11(2)17-16(10)13-5-3-4-6-15(13)19-17/h3-9,19H,1-2H3
InChI key:InChIKey=CTSPAMFJBXKSOY-UHFFFAOYSA-N
SMILES:CC1=C2C(=C(C)C=3C1=CN=CC3)NC=4C2=CC=CC4
Synonyms:- 5,11-Dimethyl-6H-pyrido(4,3-b)carbazole
- 6H-Pyrido(4,3-b)carbazole, 5,11-dimethyl-
- Brn 0221300
- Ccris 2003
- Cp 5
- Elliptisine
- Icig 770
- Nsc 71795
- Ellipticine
- 5-23-09-00417 (Beilstein Handbook Reference)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
5,11-Dimethyl-6H-Pyrido[4,3-B]Carbazole
CAS:5,11-Dimethyl-6H-Pyrido[4,3-B]CarbazolePurity:98%Molecular weight:246.31g/molEllipticine
CAS:Ellipticine is a powerful cancer drug with different actions, IC50: 0.27-1.48 μM for leukemia, breast cancer, neuroblastoma, glioblastoma.Formula:C17H14N2Purity:97.26% - 99.88%Color and Shape:SolidMolecular weight:246.31Ellipticine
CAS:Ellipticine is an alkaloid compound, which is naturally derived from the plant Apocynaceae family. It is primarily sourced from species such as *Ochrosia elliptica* and *Rauvolfia* species. Ellipticine exhibits its mode of action through intercalation into DNA strands, where it disrupts DNA replication and transcription processes. Furthermore, it impacts the action of topoisomerase II, an enzyme critical for DNA synthesis, thus exerting a potent antitumor effect.
Formula:C17H14N2Purity:Min. 95%Molecular weight:246.31 g/mol





