CymitQuimica logo

CAS 519059-04-2

:

1-(Difluoromethoxy)-4-ethynylbenzene

Description:
1-(Difluoromethoxy)-4-ethynylbenzene, identified by its CAS number 519059-04-2, is an organic compound characterized by the presence of both a difluoromethoxy group and an ethynyl group attached to a benzene ring. The difluoromethoxy group contributes to the compound's unique electronic properties, potentially enhancing its reactivity and solubility in various solvents. The ethynyl group introduces a triple bond, which can participate in further chemical reactions, such as coupling reactions or polymerization. This compound is likely to exhibit hydrophobic characteristics due to the aromatic nature of the benzene ring, while the presence of fluorine atoms may impart some degree of polarity. Additionally, the compound's structure suggests potential applications in materials science, pharmaceuticals, or as an intermediate in organic synthesis. Its stability and reactivity would depend on the specific conditions under which it is handled, including temperature and the presence of catalysts or other reagents. Safety data sheets should be consulted for handling and storage guidelines.
Formula:C9H6F2O
InChI:InChI=1S/C9H6F2O/c1-2-7-3-5-8(6-4-7)12-9(10)11/h1,3-6,9H
InChI key:InChIKey=DBBZSMZFFFJZRP-UHFFFAOYSA-N
SMILES:O(C(F)F)C1=CC=C(C#C)C=C1
Synonyms:
  • 1-(Difluoromethoxy)-4-ethynylbenzene
  • Benzene, 1-(difluoromethoxy)-4-ethynyl-
Found 6 products.