CAS 520-14-9

Myricetin 3′-glucoside

Description:

Myricetin 3′-glucoside is a flavonoid glycoside, a type of compound commonly found in various plants, particularly in fruits, vegetables, and herbs. It is characterized by its structure, which consists of a myricetin aglycone linked to a glucose molecule at the 3′ position. This compound exhibits a range of biological activities, including antioxidant, anti-inflammatory, and potential anticancer properties, making it of interest in nutritional and pharmaceutical research. Myricetin 3′-glucoside is soluble in polar solvents, and its stability can be influenced by factors such as pH and temperature. The compound is often studied for its health benefits, particularly in relation to chronic diseases, due to its ability to scavenge free radicals and modulate various biochemical pathways. Additionally, it contributes to the color and flavor of the plants in which it is found, playing a role in their overall phytochemical profile. Its CAS number, 520-14-9, is a unique identifier used to facilitate the identification and study of this specific compound in scientific literature and databases.

Formula: C₂₁H₂₀O₁₃

InChI: InChI=1S/C21H20O13/c22-5-12-15(27)17(29)19(31)21(34-12)33-11-2-6(1-9(25)14(11)26)20-18(30)16(28)13-8(24)3-7(23)4-10(13)32-20/h1-4,12,15,17,19,21-27,29-31H,5H2/t12-,15-,17+,19-,21-/m1/s1

InChI key: InChIKey=ZJYAVUPWMNHHEU-GFOOFYSOSA-N

SMILES: O=C1C=2C(OC(=C1O)C3=CC(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)=C(O)C(O)=C3)=CC(O)=CC2O

Synonyms:

• Cannabiscitrin
• 3,4′,5,5′,7-Pentahydroxyflavone 3′-glucoside
• 2-[3-(β-D-Glucopyranosyloxy)-4,5-dihydroxyphenyl]-3,5,7-trihydroxy-4H-1-benzopyran-4-one
• Myricetin 3′-glucoside
• 4H-1-Benzopyran-4-one, 2-[3-(β-D-glucopyranosyloxy)-4,5-dihydroxyphenyl]-3,5,7-trihydroxy-

Myricetin 3'-glucoside

CAS: 520-14-9

Myricetin 3'-glucoside

Formula: C₂₁H₂₀O₁₃

Purity: ≥95%

Molecular weight: 480.38

Ref: 54-OR1108203

Cannabiscitrin

CAS: 520-14-9

Formula: C₂₁H₂₀O₁₃

Purity: 95%~99%

Molecular weight: 480.378

Ref: BP-BP6191

Myricetin 3′-glucoside

CAS: 520-14-9

Formula: C₂₁H₂₀O₁₃

Purity: 95%

Molecular weight: 480.3757

Ref: IN-DA00DI56

Cannabiscitrin

CAS: 520-14-9

Cannabiscitrin is a natural flavonoid compound, which is sourced from the cannabis plant. This compound is gaining interest in the scientific community due to its unique chemical structure and potential bioactive properties. Cannabiscitrin is extracted from the various parts of the cannabis plant, where it occurs naturally alongside other flavonoids, terpenes, and cannabinoids.

Formula: C₂₁H₂₀O₁₃

Purity: Min. 95%

Molecular weight: 480.4 g/mol

Ref: 3D-AAA52014