CymitQuimica logo

CAS 5203-77-0

:

5-Hydroxy-1,3-dimethylpyrazole

Description:
5-Hydroxy-1,3-dimethylpyrazole, with the CAS number 5203-77-0, is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features hydroxyl (-OH) and two methyl (-CH3) groups attached to the pyrazole ring, contributing to its unique chemical properties. It is typically a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols. The presence of the hydroxyl group imparts some degree of acidity, while the methyl groups enhance its hydrophobic character. 5-Hydroxy-1,3-dimethylpyrazole is often studied for its potential applications in various fields, including pharmaceuticals and agrochemicals, due to its ability to act as a ligand or a building block in organic synthesis. Additionally, it may exhibit biological activity, making it of interest in medicinal chemistry. As with many organic compounds, proper handling and safety precautions are essential when working with this substance.
Formula:C5H8N2O
InChI:InChI=1/C5H8N2O/c1-4-3-5(8)7(2)6-4/h3,8H,1-2H3
InChI key:JXPVQFCUIAKFLT-UHFFFAOYSA-N
SMILES:Cc1cc(n(C)n1)O
Synonyms:
  • 1,3-Dimethyl-1H-pyrazol-5-ol
  • 1,3-Dimethyl-5-hydroxypyrazole
  • 2,5-Dimethyl-1,2-dihydropyrazol-3-one
Found 4 products.