CAS 52062-26-7

4-methoxypyridine-2,6-dicarboxylic acid

Description:

4-Methoxypyridine-2,6-dicarboxylic acid, with the CAS number 52062-26-7, is an organic compound characterized by its pyridine ring structure substituted with two carboxylic acid groups and a methoxy group. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar solvents such as water and alcohols, owing to the presence of the carboxylic acid functional groups. It has potential applications in pharmaceuticals and agrochemicals, often serving as an intermediate in the synthesis of various biologically active compounds. The presence of the methoxy group can influence its reactivity and solubility, while the dicarboxylic acid functionality can participate in various chemical reactions, including esterification and amidation. Additionally, the compound may exhibit specific biological activities, making it of interest in medicinal chemistry. As with many organic compounds, proper handling and storage are essential to maintain its stability and prevent degradation.

Formula: C₈H₇NO₅

InChI: InChI=1/C8H7NO5/c1-14-4-2-5(7(10)11)9-6(3-4)8(12)13/h2-3H,1H3,(H,10,11)(H,12,13)

SMILES: COc1cc(C(=O)O)nc(c1)C(=O)O

Synonyms:

• 2,6-Pyridinedicarboxylic Acid, 4-Methoxy-
• 4-Methoxy-2,6-pyridindicarbons?ure
• 4-Methoxy-2,6-pyridinedicarboxylic acid
• 52062-26-7
• 4-Methoxypyridine-2,6-dicarboxylic acid

4-Methoxypyridine-2,6-dicarboxylic acid

CAS: 52062-26-7

Formula: C₈H₇NO₅

Purity: 98%

Color and Shape: Solid

Molecular weight: 197.1449

Ref: IN-DA00E25S

4-Methoxypyridine-2,6-dicarboxylic acid

CAS: 52062-26-7

4-Methoxypyridine-2,6-dicarboxylic acid

Purity: 98%

Molecular weight: 197.14g/mol

Ref: 54-OR94981

4-Methoxypyridine-2,6-dicarboxylic acid

CAS: 52062-26-7

Formula: C₈H₇NO₅

Purity: 95%

Molecular weight: 197.146

Ref: 10-F541747

4-Methoxypyridine-2,6-dicarboxylic acid

CAS: 52062-26-7

4-Methoxypyridine-2,6-dicarboxylic acid is a molecule that can act as a ligand to bind metal ions. It has been shown to be able to form dicarboxylate complexes with chloride and nucleophilic metals such as zinc and copper. 4-Methoxypyridine-2,6-dicarboxylic acid has also been shown to have the ability to form duplexes with DNA, which could potentially inhibit transcription and replication. X-ray crystallography studies of 4-methoxypyridine-2,6-dicarboxylic acid reveal that it adopts a tetradentate coordination geometry with four oxygen atoms in the equatorial plane of the molecule. The molecule is also capable of forming molecular orbitals through its interactions with ligands and metal ions.

Formula: C₈H₇NO₅

Purity: Min. 95%

Molecular weight: 197.14 g/mol

Ref: 3D-CCA06226