CymitQuimica logo

CAS 52062-26-7

:

4-methoxypyridine-2,6-dicarboxylic acid

Description:
4-Methoxypyridine-2,6-dicarboxylic acid, with the CAS number 52062-26-7, is an organic compound characterized by its pyridine ring structure substituted with two carboxylic acid groups and a methoxy group. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar solvents such as water and alcohols, owing to the presence of the carboxylic acid functional groups. It has potential applications in pharmaceuticals and agrochemicals, often serving as an intermediate in the synthesis of various biologically active compounds. The presence of the methoxy group can influence its reactivity and solubility, while the dicarboxylic acid functionality can participate in various chemical reactions, including esterification and amidation. Additionally, the compound may exhibit specific biological activities, making it of interest in medicinal chemistry. As with many organic compounds, proper handling and storage are essential to maintain its stability and prevent degradation.
Formula:C8H7NO5
InChI:InChI=1/C8H7NO5/c1-14-4-2-5(7(10)11)9-6(3-4)8(12)13/h2-3H,1H3,(H,10,11)(H,12,13)
InChI key:INGKNNWONGEVCL-UHFFFAOYSA-N
SMILES:COc1cc(C(=O)O)nc(c1)C(=O)O
Synonyms:
  • 2,6-Pyridinedicarboxylic Acid, 4-Methoxy-
  • 4-Methoxy-2,6-pyridindicarbons?ure
  • 4-Methoxy-2,6-pyridinedicarboxylic acid
  • 52062-26-7
  • 4-Methoxypyridine-2,6-dicarboxylic acid
Found 6 products.