CymitQuimica logo

CAS 52089-63-1

:

1,4-Dibromobutane-2,2,3,3-d4

Description:
1,4-Dibromobutane-2,2,3,3-d4 is a deuterated organic compound, specifically a halogenated alkane. It features a four-carbon chain with two bromine atoms attached to the first and fourth carbon atoms, while the second and third carbons are substituted with deuterium isotopes, which are heavier forms of hydrogen. This compound is typically used in research and analytical chemistry, particularly in studies involving nuclear magnetic resonance (NMR) spectroscopy, where the presence of deuterium can enhance signal clarity and resolution. The presence of bromine atoms contributes to its reactivity, making it useful in various chemical synthesis processes. The deuterated nature of this compound can also influence its physical properties, such as boiling and melting points, compared to its non-deuterated counterparts. Overall, 1,4-Dibromobutane-2,2,3,3-d4 serves as a valuable tool in both synthetic and analytical chemistry applications.
Formula:C4H8Br2
InChI:InChI=1S/C4H8Br2/c5-3-1-2-4-6/h1-4H2/i1D2,2D2
InChI key:ULTHEAFYOOPTTB-LNLMKGTHSA-N
SMILES:[2H]C([2H])(CBr)C([2H])([2H])CBr
Found 1 products.