CymitQuimica logo

CAS 521-73-3

:

1,3,4(2H)-Isoquinolinetrione

Description:
1,3,4(2H)-Isoquinolinetrione, with the CAS number 521-73-3, is a heterocyclic organic compound characterized by its isoquinoline structure, which features a fused bicyclic system containing a nitrogen atom. This compound typically exhibits a trione functional group, indicating the presence of three carbonyl (C=O) groups within its molecular framework. The presence of these carbonyl groups contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. Isoquinolinetriones are known for their biological activities, including antimicrobial and anticancer properties, making them of interest in pharmaceutical research. The compound's solubility, stability, and reactivity can vary depending on the specific substituents and conditions, but it generally demonstrates moderate polarity due to the presence of both aromatic and carbonyl functionalities. Additionally, its unique structure allows for various chemical modifications, which can lead to the development of derivatives with enhanced biological activity or altered physicochemical properties. Overall, 1,3,4(2H)-Isoquinolinetrione serves as a valuable scaffold in the exploration of new therapeutic agents.
Formula:C9H5NO3
InChI:InChI=1S/C9H5NO3/c11-7-5-3-1-2-4-6(5)8(12)10-9(7)13/h1-4H,(H,10,12,13)
InChI key:InChIKey=YIOFGHHAURBGSJ-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)NC1=O)=CC=CC2
Synonyms:
  • isoquinoline-1,3,4-trione
  • 1,3,4(2H)-isoquinolinetrione
  • NSC 407248
  • Phthalonimide
  • Isoquinoline-1,3,4(2H)-trione
  • Isoquinoline-1,3,4-trione
  • 1,3,4(2H)-Isoquinolinetrione
Found 4 products.