
CAS 521-80-2
:N,N-Dimethyl-5H-dibenzo[a,d]cycloheptene-5-propanamine
Description:
N,N-Dimethyl-5H-dibenzo[a,d]cycloheptene-5-propanamine, with the CAS number 521-80-2, is an organic compound characterized by its complex bicyclic structure, which includes a dibenzo[a,d]cycloheptene framework. This compound features a propanamine functional group and two methyl groups attached to the nitrogen atom, contributing to its classification as a tertiary amine. It is typically a solid at room temperature and may exhibit a range of physical properties such as solubility in organic solvents, depending on the specific conditions. The presence of the dibenzocycloheptene moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural similarity to various biologically active compounds. Additionally, the compound may exhibit interesting electronic properties and reactivity patterns, making it a subject of interest in organic synthesis and materials science. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C20H23N
InChI:InChI=1S/C20H23N/c1-21(2)15-7-12-20-18-10-5-3-8-16(18)13-14-17-9-4-6-11-19(17)20/h3-6,8-11,13-14,20H,7,12,15H2,1-2H3
InChI key:InChIKey=YVBGGZGCBWNVDX-UHFFFAOYSA-N
SMILES:C(CCN(C)C)C1C=2C(C=CC=3C1=CC=CC3)=CC=CC2
Synonyms:- N-Methylprotriptyline
- EX 4442
- 5H-Dibenzo[a,d]cycloheptene-5-propanamine, N,N-dimethyl-
- 5H-Dibenzo[a,d]cycloheptene-5-propylamine, N,N-dimethyl-
- N,N-Dimethyl-5H-dibenzo[a,d]cycloheptene-5-propanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
