CymitQuimica logo

CAS 52159-67-8

:

Methyl 3-chloro-2-hydroxybenzoate

Description:
Methyl 3-chloro-2-hydroxybenzoate, with the CAS number 52159-67-8, is an organic compound that belongs to the class of benzoates. It features a methyl ester functional group, a chloro substituent, and a hydroxyl group on the benzene ring, which contribute to its chemical properties. This compound is typically characterized by its moderate polarity due to the presence of both the hydroxyl and ester groups, which can influence its solubility in various solvents. Methyl 3-chloro-2-hydroxybenzoate may exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Its structure allows for potential interactions with biological systems, and it may serve as a precursor or intermediate in the synthesis of more complex molecules. Additionally, the presence of the chlorine atom can impart unique reactivity patterns, making it useful in various chemical reactions. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C8H7ClO3
InChI:InChI=1S/C8H7ClO3/c1-12-8(11)5-3-2-4-6(9)7(5)10/h2-4,10H,1H3
InChI key:InChIKey=MVXSDDGVZSEOIS-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(O)C(Cl)=CC=C1
Synonyms:
  • 3-Chloro-2-hydroxybenzoic acid methyl ester
  • Benzoic acid, 3-chloro-2-hydroxy-, methyl ester
  • Methyl 3-Chloro-2-Hydroxybenzoate
  • Methyl m-chlorosalicylate
  • Methyl 3-chlorosalicylate
Found 4 products.