CymitQuimica logo

CAS 52197-12-3

:

Dicyanomethylpyrazine; 99%

Description:
Dicyanomethylpyrazine is an organic compound characterized by its pyrazine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms. This compound features two cyano (–C≡N) groups attached to a central carbon atom, contributing to its reactivity and potential applications in various chemical syntheses. It is typically a solid at room temperature and may exhibit a crystalline or powdery appearance. Dicyanomethylpyrazine is known for its high stability under normal conditions, but it can participate in nucleophilic reactions due to the electron-withdrawing nature of the cyano groups. This compound is often utilized in the synthesis of more complex organic molecules, including pharmaceuticals and agrochemicals. Additionally, it may serve as an intermediate in the production of dyes or other functional materials. Safety precautions should be observed when handling this substance, as it may pose health risks if ingested or inhaled. Proper storage in a cool, dry place away from incompatible substances is recommended to maintain its integrity.
Formula:C7H4N4
InChI:InChI=1/C7H4N4/c1-5-4-10-6(2-8)7(3-9)11-5/h4H,1H3
InChI key:RHYUBLSWHDYKAO-UHFFFAOYSA-N
SMILES:Cc1cnc(C#N)c(C#N)n1
Synonyms:
  • 2,3-Dicyano-5-methylpyrazine
  • 5-Methylpyrazine-2,3-Dicarbonitrile
Found 5 products.