CymitQuimica logo

CAS 52221-92-8

:

3-(2-Bromo-phenyl)-propan-1-ol

Description:
3-(2-Bromo-phenyl)-propan-1-ol, with the CAS number 52221-92-8, is an organic compound characterized by its structure, which includes a propanol backbone with a bromophenyl substituent. This compound features a bromine atom attached to a phenyl ring at the 2-position, which influences its reactivity and physical properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of the hydroxyl (-OH) group makes it an alcohol, contributing to its solubility in polar solvents and its potential for hydrogen bonding. This compound may exhibit moderate to high reactivity due to the bromine substituent, which can participate in nucleophilic substitution reactions. Additionally, it may have applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals, due to its functional groups that allow for further chemical modifications. Safety data should be consulted for handling and storage, as halogenated compounds can pose health and environmental risks.
Formula:C9H11BrO
InChI:InChI=1/C9H11BrO/c10-9-6-2-1-4-8(9)5-3-7-11/h1-2,4,6,11H,3,5,7H2
InChI key:VODAJGPTULSNSU-UHFFFAOYSA-N
SMILES:c1ccc(c(c1)CCCO)Br
Synonyms:
  • 3-(2-Bromophenyl)-1-propanol
Found 5 products.