CAS 52334-90-4
:3-methoxypyridin-4-amine
Description:
3-Methoxypyridin-4-amine, with the CAS number 52334-90-4, is an organic compound characterized by a pyridine ring substituted with a methoxy group and an amino group. The methoxy group (-OCH3) is located at the 3-position, while the amino group (-NH2) is at the 4-position of the pyridine ring. This compound is typically a solid at room temperature and is soluble in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. It exhibits basic properties due to the amino group, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The presence of both the methoxy and amino groups can influence its reactivity and interactions with other molecules, making it of interest in medicinal chemistry and material science. Additionally, derivatives of pyridine compounds are often studied for their biological activities, including antimicrobial and anti-inflammatory properties. Overall, 3-methoxypyridin-4-amine serves as a versatile building block in organic synthesis and pharmaceutical development.
Formula:C6H8N2O
InChI:InChI=1/C6H8N2O/c1-9-6-4-8-3-2-5(6)7/h2-4H,1H3,(H2,7,8)
SMILES:COc1c[nH]ccc1=N
Synonyms:- 4-Amino-3-methoxypyridine
- 4-Pyridinamine, 3-Methoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Amino-3-methoxypyridine
CAS:4-Amino-3-methoxypyridineFormula:C6H8N2OPurity:≥95%Color and Shape:SolidMolecular weight:124.140514-Amino-3-methoxypyridine
CAS:Formula:C6H8N2OPurity:96%Color and Shape:SolidMolecular weight:124.14054-Amino-3-methoxypyridine
CAS:4-Amino-3-methoxypyridine (4AMMP) is a naturally occurring amino acid that can be found in the nuclei of innervated tissues. It is an inhibitor of the enzyme tyrosine hydroxylase and inhibits the synthesis of catecholamines. The concentration of 4AMMP in blood was measured by radioactivity. This agent has been used for studies on the thalamic nucleus and cortex, as well as for measuring catecholamine levels in tissue homogenates.
Formula:C6H8N2OPurity:Min. 95%Molecular weight:124.14 g/mol



