CAS 5240-72-2
:Bicyclo[2.2.1]heptane-2-methanol
Description:
Bicyclo[2.2.1]heptane-2-methanol, with the CAS number 5240-72-2, is a bicyclic organic compound characterized by its unique structure, which consists of a bicyclo[2.2.1]heptane framework with a hydroxymethyl group (-CH2OH) attached to the second carbon of the ring system. This compound is typically a colorless liquid or solid at room temperature, exhibiting moderate polarity due to the presence of the hydroxymethyl group, which can participate in hydrogen bonding. Its molecular structure contributes to its potential applications in organic synthesis and as a building block in the development of more complex molecules. Bicyclo[2.2.1]heptane derivatives are of interest in various fields, including medicinal chemistry and materials science, due to their unique three-dimensional conformations and reactivity. The compound's stability and reactivity can be influenced by factors such as steric hindrance and electronic effects, making it a subject of study in both theoretical and experimental chemistry.
Formula:C8H14O
InChI:InChI=1S/C8H14O/c9-5-8-4-6-1-2-7(8)3-6/h6-9H,1-5H2
InChI key:InChIKey=LWHKUVOYICRGGR-UHFFFAOYSA-N
SMILES:C(O)C1C2CC(C1)CC2
Synonyms:- (1S,2S,4R)-bicyclo[2.2.1]hept-2-ylmethanol
- (Bicyclo[2.2.1]hept-2-yl)methanol
- 2-(Hydroxymethyl)bicyclo[2.2.1]heptane
- 2-(Hydroxymethyl)norbornane
- 2-(Hydroxymethyl)norcamphane
- 2-Norbornanemethanol
- 2-Norbornanemethanol,mixture of endo and exo
- 2-Norbornylmethanol
- 2-Norcamphanemethanol
- 3-Bicyclo[2.2.1]heptanylmethanol
- Bicyclo[2.2.1]Hept-2-Ylmethanol
- Bicyclo[2.2.1]heptan-2-ylmethanol
- Bicyclo[2.2.1]heptane-2-methanol
- Cpc 1207
- Experimental chemotherapeutant 1,207
- NSC 53599
- NSC 55693
- Norbornane-2-methanol
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Norbornane-2-methanol (endo- and exo- mixture)
CAS:Formula:C8H14OPurity:>95.0%(GC)Color and Shape:Colorless to Yellow to Orange clear liquidMolecular weight:126.20Bicyclo[2.2.1]heptan-2-ylmethanol
CAS:Formula:C8H14OPurity:%Color and Shape:LiquidMolecular weight:126.1962Bicyclo[2.2.1]heptan-2-ylmethanol
CAS:Bicyclo[2.2.1]heptan-2-ylmethanolFormula:C8H14OPurity:98%Molecular weight:126.2Bicyclo[2.2.1]heptan-2-ylmethanol
CAS:Formula:C8H14OPurity:95%Color and Shape:LiquidMolecular weight:126.199Norbornane-2-methanol
CAS:Norbornane-2-methanol is a viscosity additive in lubricants, diesel fuel, and other industrial products. It is also used as a grignard reagent for the synthesis of organic compounds. Norbornane-2-methanol has been shown to react with copper chromite to produce the reactive chemical species quadricyclane, which can be used to synthesize organic compounds. Norbornane-2-methanol also reacts with primary alcohols to form a thermally stable c–h bond. The deuterium labeled version of this compound has been used in techniques such as nuclear magnetic resonance spectroscopy and mass spectrometry.Formula:C8H14OPurity:Min. 95%Molecular weight:126.2 g/mol




