CAS 52448-14-3

4-Chloro-L-tryptophan

Description:

4-Chloro-L-tryptophan is an amino acid derivative characterized by the presence of a chlorine atom at the fourth position of the indole ring of L-tryptophan. This compound is a non-proteinogenic amino acid, meaning it is not incorporated into proteins during translation. It exhibits properties typical of amino acids, including the ability to form hydrogen bonds and participate in various biochemical reactions. The presence of the chlorine atom can influence its reactivity and interactions with biological molecules, potentially affecting its role in metabolic pathways. 4-Chloro-L-tryptophan is often used in research settings, particularly in studies related to neurotransmitter synthesis and the modulation of serotonin pathways. Its unique structure allows it to serve as a useful tool in biochemical assays and drug development. Additionally, it may exhibit specific pharmacological properties, making it of interest in medicinal chemistry. As with many chemical substances, proper handling and safety precautions are essential due to its potential biological activity.

Formula: C₁₁H₁₁ClN₂O₂

InChI: InChI=1S/C11H11ClN2O2/c12-7-2-1-3-9-10(7)6(5-14-9)4-8(13)11(15)16/h1-3,5,8,14H,4,13H2,(H,15,16)/t8-/m0/s1

InChI key: InChIKey=NRTHKYABOMUPSC-QMMMGPOBSA-N

SMILES: C([C@@H](C(O)=O)N)C=1C=2C(NC1)=CC=CC2Cl

Synonyms:

• L-Tryptophan, 4-chloro-
• (S)-4-Chlorotryptophan
• (2S)-2-Amino-3-(4-chloro-1H-indol-3-yl)propanoic acid
• 4-Chloro-L-tryptophan

4-CHLORO-L-TRYPTOPHAN

CAS: 52448-14-3

Purity: 97%

Molecular weight: 238.6699982

Ref: 10-F819275

4-Chloro-L-tryptophan

CAS: 52448-14-3

Formula: C₁₁H₁₁ClN₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 238.6702

Ref: IN-DA00DA3M

4-Chloro-L-tryptophan

CAS: 52448-14-3

4-Chloro-L-tryptophan

Formula: C₁₁H₁₁ClN₂O₂

Purity: 95%

Molecular weight: 238.67024

Ref: 54-OR452030

4-Chloro-L-tryptophan

CAS: 52448-14-3

4-Chloro-L-tryptophan is an indole alkaloid that belongs to the group of 2-d nmr. It has a chiral carbon atom and two enantiomers, D and L. 4-Chloro-L-tryptophan is used in the synthesis of serotonin in the brain. Synthesis of serotonin involves a two-step process: first, L-tyrosine is converted to 4-hydroxyphenylpyruvic acid by an aminotransferase enzyme (e.g., phenylalanine aminotransferase), then 4-hydroxyphenylpyruvic acid is converted to 4-chloro-L-tryptophan by a decarboxylase enzyme (e.g., pyridoxal phosphate). The biosynthesis of serotonin also requires an intermediate molecule called indole pyruvic acid.

Formula: C₁₁H₁₁ClN₂O₂

Purity: Min. 94 Area-%

Color and Shape: Powder

Molecular weight: 238.67 g/mol

Ref: 3D-FC141807

H-Trp(4-Cl)-OH

CAS: 52448-14-3

4-Chloro-L-tryptophan

Formula: C₁₁H₁₁ClN₂O₂

Purity: 95%

Molecular weight: 238.67

Ref: IN-DG00797063