CymitQuimica logo

CAS 52498-32-5

:

Boc-N-Methyl-L-isoleucine

Description:
Boc-N-Methyl-L-isoleucine, with the CAS number 52498-32-5, is a derivative of the amino acid isoleucine, characterized by the presence of a tert-butyloxycarbonyl (Boc) protecting group on the amino group and a methyl group on the nitrogen. This compound is typically used in peptide synthesis and as a building block in the development of pharmaceuticals and biologically active compounds. Its structure enhances the stability and solubility of the amino acid during chemical reactions. Boc-N-Methyl-L-isoleucine is generally a white to off-white solid, and it is soluble in organic solvents such as dimethyl sulfoxide (DMSO) and methanol, but less soluble in water. The presence of the Boc group allows for selective deprotection under mild acidic conditions, facilitating the synthesis of more complex molecules. Additionally, this compound may exhibit specific biological activities, making it of interest in medicinal chemistry and biochemistry research. Proper handling and storage conditions should be observed to maintain its integrity and effectiveness in applications.
Formula:C12H23NO4
InChI:InChI=1/C12H23NO4/c1-7-8(2)9(10(14)15)13(6)11(16)17-12(3,4)5/h8-9H,7H2,1-6H3,(H,14,15)/t8-,9-/m0/s1
InChI key:HTBIAUMDQYXOFG-IUCAKERBSA-N
SMILES:CC[C@H](C)[C@@H](C(=O)O)N(C)C(=O)OC(C)(C)C
Synonyms:
  • Boc-N-Me-Ile-OH
  • N-tert-Butyloxycarbonyl-N-methyl-L-isoleucine
  • N-(tert-butoxycarbonyl)-N-methyl-L-isoleucine
Found 6 products.