CAS 52602-39-8
:4-Hydroxycarbazole
Description:
4-Hydroxycarbazole is an organic compound characterized by its structure, which consists of a carbazole core with a hydroxyl group (-OH) attached to the fourth position of the aromatic ring. This compound is typically a white to pale yellow solid and is known for its potential applications in organic electronics, particularly in the development of light-emitting diodes (LEDs) and as a hole-transporting material in organic light-emitting diodes (OLEDs). It exhibits good thermal stability and has interesting photophysical properties, making it a subject of research in the field of organic semiconductors. Additionally, 4-hydroxycarbazole can participate in various chemical reactions, including oxidation and substitution reactions, due to the presence of the hydroxyl group. Its solubility in organic solvents varies, and it is generally less soluble in water. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if ingested or inhaled. Overall, 4-hydroxycarbazole is a valuable compound in both academic research and industrial applications.
Formula:C12H9NO
InChI:InChI=1S/C12H9NO/c14-11-7-3-6-10-12(11)8-4-1-2-5-9(8)13-10/h1-7,13-14H
InChI key:InChIKey=UEOHATPGKDSULR-UHFFFAOYSA-N
SMILES:OC1=C2C=3C(NC2=CC=C1)=CC=CC3
Synonyms:- 4-Carbazolol
- 4-Hydroxy Carbazole
- 4-Hydroxy-9H-carbazole
- 9H-Carbazol-4-ol
- Hydroxycarbazole
- Skf 106023
- 4-Hydroxycarbazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 11 products.
4-Hydroxycarbazole
CAS:Formula:C12H9NOPurity:>98.0%(HPLC)Color and Shape:Light yellow to Brown powder to crystalMolecular weight:183.21Ref: IN-DA003427
5g22.00€10g26.00€25g34.00€100g67.00€500g183.00€1kg318.00€5kg1,284.00€10kg2,488.00€25kg5,872.00€9H-Carbazol-4-ol
CAS:Purity:97.0%Color and Shape:Solid, Grey powderMolecular weight:183.21000671386724-Hydroxy carbazole
CAS:4-Hydroxy carbazole is a chemical compound that binds to toll-like receptor 2 (TLR2) and TLR4. It has been shown to inhibit the growth of cancer cells in mouse skin, as well as cervical cancer cells in human tissue culture. The molecule was also found to be an effective inhibitor for bacterial strains resistant to other antibiotics. 4-Hydroxy carbazole interacts with the bacterial DNA polymerase, preventing the enzyme from completing DNA synthesis. This process may result in cell death through apoptosis or necrosis. The molecule also inhibits the activity of uvb-induced enzymes, such as cytochrome P450s, which are required for activation of carcinogens and detoxification of reactive oxygen species. 4-Hydroxy carbazole binds covalently with proteins through amide linkage, leading to a stable complex that is not readily excreted by the kidney or liver. This property makes it useful for detecting proteinuria or early detection of bladder cancerFormula:C12H9NOPurity:Min. 95%Color and Shape:PowderMolecular weight:183.21 g/mol










