CymitQuimica logo

CAS 52605-97-7

:

2,3-Dimethoxypyridine

Description:
2,3-Dimethoxypyridine is an organic compound characterized by a pyridine ring substituted with two methoxy groups at the 2 and 3 positions. Its molecular formula is C8H9NO2, and it features a nitrogen atom within the aromatic ring, contributing to its basicity and potential reactivity. This compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic methoxy groups. 2,3-Dimethoxypyridine is often used in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. Its unique structure allows it to participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, it may exhibit biological activity, making it of interest in medicinal chemistry. Proper handling and storage are essential, as with many organic compounds, to ensure safety and stability.
Formula:C7H9NO2
InChI:InChI=1/C7H9NO2/c1-9-6-4-3-5-8-7(6)10-2/h3-5H,1-2H3
InChI key:QHUHPERZCBUMRK-UHFFFAOYSA-N
SMILES:COc1cccnc1OC
Synonyms:
  • Pyridine, 2,3-dimethoxy-
Found 6 products.