CAS 5266-48-8
:N-A-P-tosyl-L-lysine methyl ester hcl
Description:
N-A-P-tosyl-L-lysine methyl ester hydrochloride, with the CAS number 5266-48-8, is a chemical compound that serves as a derivative of the amino acid lysine. It features a tosyl (p-toluenesulfonyl) group, which enhances its reactivity and solubility, making it useful in various synthetic applications, particularly in peptide synthesis and as a protecting group in organic chemistry. The methyl ester form indicates that the carboxylic acid group of lysine is esterified, which can influence its biological activity and solubility in organic solvents. As a hydrochloride salt, it is typically more stable and easier to handle than its free base form. This compound is often utilized in biochemical research and pharmaceutical development due to its ability to participate in coupling reactions and its role in the synthesis of more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices are followed.
Formula:C14H23ClN2O4S
InChI:InChI=1/C14H22N2O4S.ClH/c1-11-6-8-12(9-7-11)21(18,19)16-13(14(17)20-2)5-3-4-10-15;/h6-9,13,16H,3-5,10,15H2,1-2H3;1H/t13-;/m0./s1
SMILES:Cc1ccc(cc1)S(=O)(=O)N[C@@H](CCCCN)C(=O)OC.Cl
Synonyms:- Tos-Lys-OMe . HCl
- N-[P-Toluenesulfonyl]-L-Lysine Methyl Ester Hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
N-[P-Toluenesulfonyl]-l-lysine methyl ester hydrochloride
CAS:N-[P-Toluenesulfonyl]-l-lysine methyl ester hydrochlorideFormula:C14H23ClN2O4SPurity:95%Molecular weight:350.86N-[P-Toluenesulfonyl]-l-lysine methyl ester HCl
CAS:Formula:C14H23ClN2O4SPurity:95%Color and Shape:SolidMolecular weight:350.8614Tos-Lys-OMe.HCl
CAS:Tos-Lys-OMe.HCl is a peptide substrate for the enzyme trypsin, which is an endopeptidase that cleaves proteins to smaller fragments. Tos-Lys-OMe.HCl is used in the study of proteolytic enzyme action and as a tool in biochemical research.Formula:C14H22N2O4S•HCIPurity:Min. 95%Molecular weight:350.86 g/mol(S)-Methyl 6-amino-2-(4-methylphenylsulfonamido)hexanoate hydrochloride
CAS:Formula:C14H23ClN2O4SPurity:97%Molecular weight:350.86



