CAS 52663-69-1: PCB 183
Description:PCB 183, or polychlorinated biphenyl 183, is a member of the polychlorinated biphenyl (PCB) family, which consists of synthetic organic chemicals with varying degrees of chlorination. Characterized by its complex structure, PCB 183 contains multiple chlorine atoms attached to a biphenyl backbone, influencing its physical and chemical properties. It is typically a colorless to light yellow solid or viscous liquid, depending on temperature and concentration. PCB 183 is known for its hydrophobic nature, low volatility, and high thermal stability, making it resistant to degradation in the environment. However, like other PCBs, it is persistent in ecosystems and can bioaccumulate in the food chain, raising concerns regarding its toxicity and potential health effects on humans and wildlife. PCBs, including PCB 183, have been associated with various adverse health outcomes, including endocrine disruption and carcinogenic effects. Due to these environmental and health risks, the production and use of PCBs have been heavily regulated or banned in many countries.
Formula:C12H3Cl7
InChI:InChI=1S/C12H3Cl7/c13-5-2-7(15)6(14)1-4(5)10-8(16)3-9(17)11(18)12(10)19/h1-3H
InChI key:InChIKey=KQBFUDNJKCZEDQ-UHFFFAOYSA-N
SMILES:ClC1=CC(Cl)=C(C=C1Cl)C2=C(Cl)C=C(Cl)C(Cl)=C2Cl
- Synonyms:
- (±)-Pcb 183
- 1,1'-Biphenyl, 2,2',3,4,4',5',6-Heptachloro-
- 1,1′-Biphenyl, 2,2′,3,4,4′,5′,6-heptachloro-
- 2,2',3,4,4',5',6-Pcb
- 2,2′,3,4,4′,5′,6-Heptachloro-1,1′-biphenyl
- 2,2′,3,4,4′,5′,6-Heptachlorobiphenyl
- 2,3,4,6,2′,4′,5′-Heptachlorobiphenyl
- 2,4,5,2′,3′,4′,6′-Heptachlorobiphenyl
- 52663-69-1
