CAS 52718-95-3
:2-Bromo-3-pyridinecarboxylic acid methyl ester
Description:
2-Bromo-3-pyridinecarboxylic acid methyl ester, with the CAS number 52718-95-3, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a bromine substituent at the 2-position and a methyl ester functional group at the 3-position of the pyridine ring. It is typically a white to off-white solid and is soluble in organic solvents such as methanol and dichloromethane, but may have limited solubility in water due to its hydrophobic characteristics. The presence of the bromine atom introduces notable reactivity, making it useful in various chemical synthesis applications, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the methyl ester group can undergo hydrolysis to yield the corresponding carboxylic acid, which may exhibit different biological activities. As with many halogenated compounds, appropriate safety measures should be taken when handling this substance due to potential toxicity and environmental concerns.
Formula:C7H6BrNO2
InChI:InChI=1/C7H6BrNO2/c1-11-7(10)5-3-2-4-9-6(5)8/h2-4H,1H3
SMILES:COC(=O)C1=C(Br)N=CC=C1
Synonyms:- 3-Pyridinecarboxylic Acid, 2-Bromo-, Methyl Ester
- Methyl 2-bromonicotinate
- Methyl 2-bromopyridine-3-carboxylate
- T6Nj Be Cvo1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Methyl 2-Bromonicotinate
CAS:Formula:C7H6BrNO2Purity:>98.0%(GC)Color and Shape:White or Colorles to Yellow to Orange powder to lump to clear liquidMolecular weight:216.03Methyl 2-bromonicotinate
CAS:Methyl 2-bromonicotinateFormula:C7H6BrNO2Purity:≥95%Color and Shape:Solid-Low MeltMolecular weight:216.032043-Pyridinecarboxylic acid, 2-bromo-, methyl ester
CAS:Formula:C7H6BrNO2Purity:97%Color and Shape:SolidMolecular weight:216.0320Methyl 2-bromonicotinate
CAS:Formula:C7H6BrNO2Purity:97%Color and Shape:SolidMolecular weight:216.034



