CAS 52723-82-7
:4-bromo-5-fluoro-2-methyl-aniline
Description:
4-Bromo-5-fluoro-2-methyl-aniline is an organic compound characterized by the presence of both bromine and fluorine substituents on an aniline structure, which is an aromatic amine. The compound features a methyl group attached to the benzene ring, contributing to its overall hydrophobic character. Its molecular structure includes a bromine atom at the para position and a fluorine atom at the meta position relative to the amino group, which influences its reactivity and physical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, while being less soluble in water due to its hydrophobic nature. The presence of halogens can enhance its reactivity in various chemical reactions, making it useful in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the compound's unique combination of substituents can affect its electronic properties, potentially influencing its behavior in biological systems and its interactions with other chemical entities. Safety data should be consulted for handling and usage, as halogenated compounds can pose health risks.
Formula:C7H7BrFN
InChI:InChI=1/C7H7BrFN/c1-4-2-5(8)6(9)3-7(4)10/h2-3H,10H2,1H3
SMILES:Cc1cc(c(cc1N)F)Br
Synonyms:- 4-Bromo-5-fluoro-2-methylaniline
- Benzenamine, 4-bromo-5-fluoro-2-methyl-
- 2-Amino-4-fluoro-5-bromotoluene
- 4-bromo-5-fluoro-2-methylbenzenamine
- Methyl-4-bromo-5-fluoroaniline
- 2-Methyl-4-bromo-5-fluoroaniline
- 4-Bromo-5-fluoro-o-toluidine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Bromo-5-fluoro-2-methylaniline
CAS:4-Bromo-5-fluoro-2-methylanilineFormula:C7H7BrFNPurity:97%Color and Shape:SolidMolecular weight:204.039584-Bromo-5-fluoro-2-methylaniline
CAS:Formula:C7H7BrFNPurity:98%Color and Shape:SolidMolecular weight:204.03964-Bromo-5-fluoro-2-methylaniline
CAS:Formula:C7H7BrFNPurity:97%Color and Shape:SolidMolecular weight:204.0424-Bromo-5-fluoro-2-methylaniline
CAS:4-Bromo-5-fluoro-2-methylaniline is a fine chemical that is used as a building block in the synthesis of other chemicals. It is also used as a research chemical and can be found in certain pharmaceuticals. 4-Bromo-5-fluoro-2-methylaniline has been shown to be an intermediate for the synthesis of various drugs, such as fluoxetine and lorcaserin. This useful scaffold can also be used in reactions to produce amines, amides, and nitriles.Formula:C7H7BrFNPurity:Min. 95%Color and Shape:PowderMolecular weight:204.04 g/mol4-Bromo-5-fluoro-2-methylaniline
CAS:4-Bromo-5-fluoro-2-methylanilineFormula:C7H7BrFNPurity:98%Molecular weight:204.04




