CAS 52811-37-7: (2,5-dihydroxy-4-methoxyphenyl)(phenyl)methanone

Description:(2,5-Dihydroxy-4-methoxyphenyl)(phenyl)methanone, with the CAS number 52811-37-7, is an organic compound characterized by its complex structure, which includes a phenyl group and a ketone functional group. This compound features two hydroxyl groups and a methoxy group on the aromatic ring, contributing to its potential reactivity and solubility properties. The presence of hydroxyl groups typically enhances hydrogen bonding capabilities, which can influence its solubility in polar solvents. The methoxy group, being an electron-donating substituent, can affect the electronic properties of the aromatic system, potentially enhancing its reactivity in electrophilic aromatic substitution reactions. This compound may exhibit biological activity, making it of interest in pharmaceutical and biochemical research. Its structural features suggest potential applications in various fields, including organic synthesis and materials science. However, specific properties such as melting point, boiling point, and spectral data would require experimental determination or literature reference for precise characterization.

Formula:C₁₄H₁₂O₄

InChI:InChI=1/C14H12O4/c1-18-13-8-11(15)10(7-12(13)16)14(17)9-5-3-2-4-6-9/h2-8,15-16H,1H3

Found 3 products.

Product data	Purity	Price range	Estimated delivery
Cearoin REF: IN-DA00DPOKCAS: 52811-37-7	- - -	To inquire	Wed 23 Apr 25
Cearoin REF: TM-TN3614CAS: 52811-37-7	98%	To inquire	Thu 24 Apr 25
Cearoin REF: 3D-CCA81137CAS: 52811-37-7	Min. 95%	348.00 €~5,767.00 €	Wed 16 Jul 25