CAS 52811-37-7

(2,5-dihydroxy-4-methoxyphenyl)(phenyl)methanone

Description:

(2,5-Dihydroxy-4-methoxyphenyl)(phenyl)methanone, with the CAS number 52811-37-7, is an organic compound characterized by its complex structure, which includes a phenyl group and a ketone functional group. This compound features two hydroxyl groups and a methoxy group on the aromatic ring, contributing to its potential reactivity and solubility properties. The presence of hydroxyl groups typically enhances hydrogen bonding capabilities, which can influence its solubility in polar solvents. The methoxy group, being an electron-donating substituent, can affect the electronic properties of the aromatic system, potentially enhancing its reactivity in electrophilic aromatic substitution reactions. This compound may exhibit biological activity, making it of interest in pharmaceutical and biochemical research. Its structural features suggest potential applications in various fields, including organic synthesis and materials science. However, specific properties such as melting point, boiling point, and spectral data would require experimental determination or literature reference for precise characterization.

Formula: C₁₄H₁₂O₄

InChI: InChI=1/C14H12O4/c1-18-13-8-11(15)10(7-12(13)16)14(17)9-5-3-2-4-6-9/h2-8,15-16H,1H3

SMILES: COc1cc(c(cc1O)C(=O)c1ccccc1)O

Cearoin

CAS: 52811-37-7

Formula: C₁₄H₁₂O₄

Purity: 98%

Molecular weight: 244.2427

Ref: IN-DA00DPOK

Cearoin

CAS: 52811-37-7

Cearoin is a natural product, anticancer by inducing autophagy, ERK activation, and apoptosis in SH-SY5Y neuroblastoma cells through ROS generation.

Formula: C₁₄H₁₂O₄

Purity: 99.17%

Color and Shape: Solid

Molecular weight: 244.24

Ref: TM-TN3614

Cearoin

CAS: 52811-37-7

Please enquire for more information about Cearoin including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₄H₁₂O₄

Purity: Min. 95%

Molecular weight: 244.24 g/mol

Ref: 3D-CCA81137