CymitQuimica logo

CAS 52849-52-2

:

4-bromo-2-ethoxy-1-methoxybenzene

Description:
4-Bromo-2-ethoxy-1-methoxybenzene, with the CAS number 52849-52-2, is an organic compound that belongs to the class of substituted phenols. This compound features a benzene ring substituted with a bromine atom, an ethoxy group, and a methoxy group, which contribute to its chemical properties and reactivity. The presence of these substituents can influence the compound's polarity, solubility, and potential interactions with other chemical species. Typically, compounds like this may exhibit moderate to low solubility in water but can be more soluble in organic solvents due to their hydrophobic aromatic structure. The bromine atom can serve as a site for further chemical reactions, such as nucleophilic substitution, while the ethoxy and methoxy groups can affect the electron density on the aromatic ring, influencing its reactivity in electrophilic aromatic substitution reactions. Additionally, the compound may have applications in organic synthesis and materials science, depending on its specific reactivity and properties. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C9H11BrO2
InChI:InChI=1/C9H11BrO2/c1-3-12-9-6-7(10)4-5-8(9)11-2/h4-6H,3H2,1-2H3
InChI key:WWHVUIQBSPEWNK-UHFFFAOYSA-N
SMILES:CCOc1cc(ccc1OC)Br
Synonyms:
  • Benzene, 4-Bromo-2-Ethoxy-1-Methoxy-
Found 3 products.