CAS 52949-83-4
:Ajugol
Description:
Ajugol, with the CAS number 52949-83-4, is a chemical compound derived from the plant Ajuga reptans, commonly known as bugleweed. It is classified as a triterpenoid saponin, which contributes to its biological activity. Ajugol exhibits a range of pharmacological properties, including anti-inflammatory, antimicrobial, and potential anticancer effects, making it of interest in medicinal chemistry and natural product research. The compound is typically characterized by its complex molecular structure, which includes multiple rings and functional groups that contribute to its solubility and reactivity. Ajugol's mechanism of action is thought to involve modulation of various biochemical pathways, although detailed studies are ongoing to fully elucidate its effects. Additionally, its safety profile and potential therapeutic applications are subjects of research, particularly in the context of herbal medicine and phytotherapy. As with many natural compounds, the extraction and purification processes can significantly influence its efficacy and bioavailability.
Formula:C15H24O9
InChI:InChI=1S/C15H24O9/c1-15(21)4-7(17)6-2-3-22-13(9(6)15)24-14-12(20)11(19)10(18)8(5-16)23-14/h2-3,6-14,16-21H,4-5H2,1H3/t6-,7+,8+,9+,10+,11-,12+,13-,14-,15-/m0/s1
InChI key:InChIKey=VELYAQRXBJLJAK-XKKWFBPMSA-N
SMILES:O([C@H]1[C@]2([C@]([C@H](O)C[C@]2(C)O)(C=CO1)[H])[H])[C@H]3[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O3
Synonyms:- Ajugol
- β-D-Glucopyranoside, 1,4a,5,6,7,7a-hexahydro-5,7-dihydroxy-7-methylcyclopenta[c]pyran-1-yl, [1S-(1α,4aα,5α,7α,7aα)]-
- β-D-Glucopyranoside, (1S,4aR,5R,7S,7aS)-1,4a,5,6,7,7a-hexahydro-5,7-dihydroxy-7-methylcyclopenta[c]pyran-1-yl
- (1S,4aR,5R,7S,7aS)-1,4a,5,6,7,7a-Hexahydro-5,7-dihydroxy-7-methylcyclopenta[c]pyran-1-yl β-D-glucopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
Ajugol
CAS:Ajugol analytical standard provided with w/w absolute assay, to be used for quantitative titration.Formula:C15H24O9Purity:(HPLC) ≥98%Color and Shape:PowderMolecular weight:348.35Ajugol (Standard)
CAS:Ajugol (Standard) is a reference standard for research and analysis in studies involving Ajugol. Ajugol (Leonuride) shows some trypanocidal potential against Trypanosoma brucei rhodesiense (IC50 values 29.3–73.0 ug/ml).Formula:C15H24O9Color and Shape:SolidMolecular weight:348.35Leonuride
CAS:Ajugol shows some trypanocidal potential against Trypanosoma brucei rhodesiense (IC50 values 29.3–73.0 ug/ml).Formula:C15H24O9Purity:95%~99%Molecular weight:348.348Ajugol
CAS:Ajugol (Leonuride) shows some trypanocidal potential against Trypanosoma brucei rhodesiense (IC50 values 29.3–73.0 ug/ml).Formula:C15H24O9Purity:99.15% - 99.91%Color and Shape:SolidMolecular weight:348.35Ref: TM-T3792
2mg40.00€5mg56.00€1mL*10mM (DMSO)63.00€10mg80.00€25mg114.00€50mg167.00€100mg240.00€200mg355.00€Ajugol
CAS:Ajugol is a natural compound, specifically an iridoid glycoside, which is primarily sourced from plants belonging to the Lamiaceae family. It is particularly abundant in species such as Ajuga decumbens and other related Ajuga species. As a secondary metabolite, Ajugol has attracted scientific interest due to its bioactive properties.Formula:C15H24O9Purity:Min. 98 Area-%Color and Shape:White Off-White PowderMolecular weight:348.35 g/molAjugol
CAS:(2S,3R,4S,5S,6R)-2-(((1S,4aR,5R,7S,7aS)-5,7-Dihydroxy-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-1-yl)oxy)-6-(hydroxymethyl)tetrahydro-2H-pyran-3,4,5-triolFormula:C15H24O9Purity:98+%Molecular weight:348.35








