CAS 5299-60-5
:Ethyl 6-hydroxyhexanoate
Description:
Ethyl 6-hydroxyhexanoate, with the CAS number 5299-60-5, is an ester derived from hexanoic acid and ethanol. This compound typically appears as a colorless to pale yellow liquid with a pleasant fruity odor, characteristic of many esters. It is soluble in organic solvents and exhibits limited solubility in water due to its hydrophobic hexanoate chain. Ethyl 6-hydroxyhexanoate is known for its applications in the flavor and fragrance industry, where it is used to impart fruity notes in various products. Additionally, it may serve as an intermediate in organic synthesis and in the production of other chemical compounds. The presence of the hydroxy group contributes to its reactivity, allowing for potential participation in various chemical reactions, such as esterification and transesterification. Safety data indicates that, like many organic compounds, it should be handled with care, as it may cause irritation upon contact with skin or eyes. Proper storage and handling protocols are essential to ensure safety in laboratory and industrial settings.
Formula:C8H16O3
InChI:InChI=1/C8H16O3/c1-2-11-8(10)6-4-3-5-7-9/h9H,2-7H2,1H3
InChI key:InChIKey=HYXRUZUPCFVWAH-UHFFFAOYSA-N
SMILES:C(CCCCCO)(OCC)=O
Synonyms:- Ethyl 6-hydroxycaproate
- 5-Ethoxycarbonylpentan-1-ol
- Ethyl ε-hydroxycaproate
- Ethyl 6-hydroxyhexanoate
- Hexanoic acid, 6-hydroxy-, ethyl ester
- 6-Hydroxyhexanoic acid ethyl ester
- 6-Hydroxycaproic acid ethyl ester
- Ethyl 6-hydroxyhexanoate 97%
- RARECHEM AK ML 0053
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
Ethyl 6-hydroxyhexanoate
CAS:Formula:C8H16O3Purity:95%Color and Shape:LiquidMolecular weight:160.2108Ethyl 6-hydroxyhexanoate
CAS:Ethyl 6-hydroxyhexanoateFormula:C8H16O3Purity:99%Molecular weight:160.213Ethyl 6-hydroxyhexanoate
CAS:Ethyl 6-hydroxyhexanoateFormula:C8H16O3Purity:≥98%Molecular weight:160.21Ethyl 6-hydroxyhexanoate
CAS:Ethyl 6-hydroxyhexanoate can be used to synthesize 2-Bu suberic acid.Formula:C8H16O3Purity:97.06%Color and Shape:SolidMolecular weight:160.21Ethyl 6-Hydroxyhexanoate
CAS:Formula:C8H16O3Purity:>95.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:160.21Ethyl 6-Hydroxyhexanoate
CAS:Controlled ProductFormula:C8H16O3Color and Shape:NeatMolecular weight:160.21Ethyl 6-Hydroxyhexanoate
CAS:Ethyl 6-hydroxyhexanoateFormula:C8H16O3Purity:95%Molecular weight:160.21Ethyl 6-Hydroxyhexanoate
CAS:Ethyl 6-hydroxyhexanoate is an ester with the chemical formula CH3COOC2H5. It is a colorless liquid that can be prepared by the reaction of ethyl alcohol and acetyl chloride. Ethyl 6-hydroxyhexanoate has been shown to react with amines at a rate that is faster than the reaction rate for fatty acids, which may be due to its higher surface area. This ester also reacts with primary alcohols to form esters or ethers. The functional groups on ethyl 6-hydroxyhexanoate include carboxylic acid, hydroxyl group, and primary alcohol.
Formula:C8H16O3Purity:Min. 95%Molecular weight:160.21 g/mol








