CymitQuimica logo

CAS 5305-45-3

:

4,6-Dichloropyrimidine-5-carbonitrile

Description:
4,6-Dichloropyrimidine-5-carbonitrile is a heterocyclic organic compound characterized by a pyrimidine ring substituted with two chlorine atoms and a cyano group. The presence of chlorine atoms at the 4 and 6 positions of the pyrimidine ring contributes to its reactivity and potential applications in various chemical reactions. The cyano group at the 5 position enhances the compound's polarity and can participate in nucleophilic reactions, making it useful in synthetic organic chemistry. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its structure allows for potential applications in pharmaceuticals, agrochemicals, and as an intermediate in the synthesis of other complex molecules. Additionally, the presence of halogens can influence the compound's biological activity, making it a subject of interest in medicinal chemistry. Safety precautions should be taken when handling this compound, as halogenated compounds can pose health risks.
Formula:C5HCl2N3
InChI:InChI=1/C5HCl2N3/c6-4-3(1-8)5(7)10-2-9-4/h2H
InChI key:IPEBKIMUIHKZJP-UHFFFAOYSA-N
SMILES:C(#N)c1c(Cl)ncnc1Cl
Synonyms:
  • 4,6-Dichloro-5-cyanopyrimidine
  • 4,6-Dichloro-5-pyrimidinecarbonitrile
  • 5-Pyrimidinecarbonitrile, 4,6-dichloro-
Found 4 products.