CymitQuimica logo

CAS 5305-59-9

:

4-Amino-6-chloropyrimidine

Description:
4-Amino-6-chloropyrimidine is an organic compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. This compound features an amino group (-NH2) at the 4-position and a chlorine atom at the 6-position of the pyrimidine ring, contributing to its reactivity and potential applications in various chemical reactions. It is typically a white to off-white crystalline solid, soluble in polar solvents like water and alcohols, and exhibits basic properties due to the presence of the amino group. 4-Amino-6-chloropyrimidine is of interest in medicinal chemistry and agricultural chemistry, often serving as an intermediate in the synthesis of pharmaceuticals and agrochemicals. Its reactivity can be attributed to the electron-withdrawing nature of the chlorine atom, which influences the compound's nucleophilicity and electrophilicity. Safety data should be consulted for handling, as with many chemical substances, to ensure proper precautions are taken during use.
Formula:C4H4ClN3
InChI:InChI=1/C4H4ClN3/c5-3-1-4(6)8-2-7-3/h1-2H,(H2,6,7,8)
InChI key:DUKKRSPKJMHASP-UHFFFAOYSA-N
SMILES:c1c(Cl)nc[nH]c1=N
Synonyms:
  • 6-Chloro-4-Aminopyrimidine
  • 6-Chloropyrimidin-4-Amine
  • 6-Amino-4-chloropyrimidine
Found 5 products.