CAS 53064-79-2
:Iodomethyl 2,2-dimethylpropanoate
Description:
Iodomethyl 2,2-dimethylpropanoate is an organic compound characterized by its ester functional group and the presence of an iodine atom. It features a branched alkyl chain, specifically a 2,2-dimethylpropanoate moiety, which contributes to its steric properties and reactivity. The iodine atom in the iodomethyl group enhances its electrophilic character, making it a potential substrate for nucleophilic substitution reactions. This compound is typically a colorless to pale yellow liquid with a distinctive odor, and it is soluble in organic solvents. Its molecular structure allows for various applications in organic synthesis, particularly in the formation of carbon-carbon bonds and as an intermediate in the synthesis of more complex molecules. Additionally, due to the presence of iodine, it may exhibit unique properties such as increased reactivity in certain chemical reactions. Safety precautions should be taken when handling this compound, as it may pose health risks associated with iodine and organic esters.
Formula:C6H11IO2
InChI:InChI=1S/C6H11IO2/c1-6(2,3)5(8)9-4-7/h4H2,1-3H3
InChI key:InChIKey=PELJISAVHGXLAL-UHFFFAOYSA-N
SMILES:C(C(C)(C)C)(OCI)=O
Synonyms:- (Pivaloyloxy)methyl iodide
- 2,2-Dimethylpropionic acid iodomethyl ester
- Iodomethyl 2,2-Dimethylpropanoate
- Iodomethyl 2,2-dimethylpropionate
- Pivalic acid iodomethyl ester
- Propanoic acid, 2,2-dimethyl-, iodomethyl ester
- Iodomethyl pivalate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Iodomethyl Pivalate (stabilized with Copper chip)
CAS:Formula:C6H11IO2Purity:>98.0%(GC)Color and Shape:Colorless to Brown clear liquidMolecular weight:242.062,2-Dimethylpropionic acid iodomethyl ester
CAS:Formula:C6H11IO2Purity:95%Color and Shape:LiquidMolecular weight:242.0548Iodomethyl pivalate
CAS:Iodomethyl pivalateFormula:C6H11IO2Purity:98% (stabilized with Copper chip)Molecular weight:242.05Iodomethyl pivalate
CAS:Iodomethyl pivalate is a synthetic trifluoromethyl derivative of epidermal growth factor (EGF). It is used as a reagent for the detection of EGF in biological fluids. Iodomethyl pivalate reacts with EGF to form a covalent bond and then reacts with sodium carbonate or sodium bicarbonate to form an iodinated product, which can be detected using reversed-phase high-performance liquid chromatography. This reaction mechanism has been shown to have a detection sensitivity of about 1.0 pg/ml and pharmacokinetic properties that allow for the measurement of EGF in human serum.Formula:C6H11IO2Purity:Min. 95%Color and Shape:Yellow Clear LiquidMolecular weight:242.05 g/molIodomethyl Pivalate
CAS:Controlled ProductFormula:C6H11IO2Color and Shape:NeatMolecular weight:242.05






