CAS 53078-85-6
:2-Bromo-5-methylbenzenamine
Description:
2-Bromo-5-methylbenzenamine, also known as 2-bromo-5-methyl-aniline, is an organic compound characterized by its aromatic structure, which includes a bromine atom and an amino group attached to a methyl-substituted benzene ring. The presence of the bromine atom introduces notable reactivity, making it a useful intermediate in various chemical syntheses, particularly in the production of pharmaceuticals and agrochemicals. The amino group (-NH2) contributes to its basicity and potential for forming hydrogen bonds, influencing its solubility in polar solvents. This compound typically appears as a solid at room temperature and may exhibit moderate toxicity, necessitating careful handling. Its molecular structure allows for electrophilic substitution reactions, making it a versatile building block in organic synthesis. Additionally, the compound's physical properties, such as melting point and boiling point, can vary based on purity and environmental conditions. Overall, 2-Bromo-5-methylbenzenamine is significant in synthetic organic chemistry due to its functional groups and reactivity profile.
Formula:C7H8BrN
InChI:InChI=1/C7H8BrN/c1-5-2-3-6(8)7(9)4-5/h2-4H,9H2,1H3
SMILES:Cc1ccc(c(c1)N)Br
Synonyms:- 2-Bromo-5-methylaniline
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-Bromo-5-methylaniline
CAS:2-Bromo-5-methylanilineFormula:C7H8BrNPurity:98%Color and Shape:Solid-FusedMolecular weight:186.049112-Bromo-5-methylaniline
CAS:Formula:C7H8BrNPurity:>97.0%(GC)(T)Color and Shape:White to Orange to Green powder to lumpMolecular weight:186.052-Bromo-5-methylaniline
CAS:2-Bromo-5-methylaniline is an insecticide that is used to control a number of pests, such as flies and mosquitoes. It has been shown to be effective against plasmodium falciparum, the parasite responsible for causing malaria. 2-Bromo-5-methylaniline inhibits the growth of plasmodium by interfering with the synthesis of proteins vital for cell division. This drug can cause unintended effects on other insects and mammals, which may be due to its ability to inhibit acetylcholinesterase activity in humans and rats, leading to paralysis. 2-Bromo-5-methylaniline is also a product of palladium catalyzed reactions with isocryptolepine, a chemical compound that has been shown to have antiplasmodial properties.Formula:C7H8BrNPurity:Min. 95%Color and Shape:White To Brown SolidMolecular weight:186.05 g/mol2-Bromo-5-methylaniline
CAS:Formula:C7H8BrNPurity:98%Color and Shape:Low Melting SolidMolecular weight:186.052





