CymitQuimica logo

CAS 53078-85-6

:

2-Bromo-5-methylbenzenamine

Description:
2-Bromo-5-methylbenzenamine, also known as 2-bromo-5-methyl-aniline, is an organic compound characterized by its aromatic structure, which includes a bromine atom and an amino group attached to a methyl-substituted benzene ring. The presence of the bromine atom introduces notable reactivity, making it a useful intermediate in various chemical syntheses, particularly in the production of pharmaceuticals and agrochemicals. The amino group (-NH2) contributes to its basicity and potential for forming hydrogen bonds, influencing its solubility in polar solvents. This compound typically appears as a solid at room temperature and may exhibit moderate toxicity, necessitating careful handling. Its molecular structure allows for electrophilic substitution reactions, making it a versatile building block in organic synthesis. Additionally, the compound's physical properties, such as melting point and boiling point, can vary based on purity and environmental conditions. Overall, 2-Bromo-5-methylbenzenamine is significant in synthetic organic chemistry due to its functional groups and reactivity profile.
Formula:C7H8BrN
InChI:InChI=1/C7H8BrN/c1-5-2-3-6(8)7(9)4-5/h2-4H,9H2,1H3
InChI key:QTAQWOXSUFGGKH-UHFFFAOYSA-N
SMILES:Cc1ccc(c(c1)N)Br
Synonyms:
  • 2-Bromo-5-methylaniline
Found 5 products.