CAS 53100-44-0
:1-(1,1-Dimethylethyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate
Description:
1-(1,1-Dimethylethyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate, with the CAS number 53100-44-0, is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered cyclic amine. This compound features two carboxylate groups, contributing to its potential as a dicarboxylic acid derivative. The presence of the tert-butyl group (1,1-dimethylethyl) enhances its steric bulk, which can influence its reactivity and solubility in various solvents. The (2S) configuration indicates that it has a specific stereochemistry, which can affect its biological activity and interactions with other molecules. Typically, compounds like this may be of interest in organic synthesis, pharmaceuticals, or agrochemicals due to their unique structural features. Additionally, the oxo group (carbonyl) plays a crucial role in reactivity, potentially participating in various chemical reactions such as nucleophilic attacks or condensation reactions. Overall, this compound exemplifies the complexity and diversity of organic molecules in chemical research and applications.
Formula:C10H15NO5
InChI:InChI=1S/C10H15NO5/c1-10(2,3)16-9(15)11-6(8(13)14)4-5-7(11)12/h6H,4-5H2,1-3H3,(H,13,14)/t6-/m0/s1
InChI key:InChIKey=MJLQPFJGZTYCMH-LURJTMIESA-N
SMILES:C(OC(C)(C)C)(=O)N1[C@H](C(O)=O)CCC1=O
Synonyms:- (2S)-1-[(2-Methylpropan-2-yl)oxycarbonyl]-5-oxopyrrolidine-2-carboxylic acid
- (2S)-1-[(tert-Butoxy)carbonyl]-5-oxopyrrolidine-2-carboxylic acid
- (S)-1-(tert-Butoxycarbonyl)-5-oxopyrrolidine-2-carboxylic acid
- (S)-5-Oxo-1,2-pyrrolidinedicarboxylic acid, 1-(1,1-dimethylethyl) ester
- 1,2-Pyrrolidinedicarboxylic acid, 5-oxo-, 1-(1,1-dimethylethyl) ester, (2S)-
- 1,2-Pyrrolidinedicarboxylic acid, 5-oxo-, 1-(1,1-dimethylethyl) ester, (S)-
- 1-(1,1-Dimethylethyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate
- 1-(tert-butoxycarbonyl)-5-oxo-L-proline
- BOC-L-Pyroglutamic acid
- Boc-Pyr-Oh
- N-Boc-5-oxo-L-proline
- N-Boc-<span class="text-smallcaps">L</span>-pyroglutamic acid
- N-tert-Butoxycarbonyl-<span class="text-smallcaps">L</span>-pyroglutamic acid
- Z-Leu DCHA
- N-Boc-L-pyroglutamic acid
- 1-(tert-Butyl) hydrogen (S)-5-oxopyrrolidine-1,2-dicarboxylate
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
N-(tert-Butoxycarbonyl)-L-pyroglutamic Acid
CAS:Formula:C10H15NO5Purity:>98.0%(T)(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:229.23Boc-Pyr-OH
CAS:Bachem ID: 4026369.
Formula:C10H15NO5Purity:99.39%Color and Shape:White PowderMolecular weight:229.23(S)-Boc-5-Oxopyrrolidine-2-carboxylic acid
CAS:(S)-Boc-5-Oxopyrrolidine-2-carboxylic acidFormula:C10H15NO5Purity:98%Color and Shape:SolidMolecular weight:229.2298(S)-Boc-5-oxopyrrolidine-2-carboxylic acid
CAS:Formula:C10H15NO5Purity:≥ 98.0%Color and Shape:White to off-white solidMolecular weight:229.23Boc-Pyr-OH
CAS:Boc-Pyr-OH is a synthetic compound with medical applications. It is used as an anti-inflammatory agent and has been shown to be effective in the treatment of mouse tumor cells. Boc-Pyr-OH binds to plasma proteins and can be detected in the blood following administration. The drug has a high affinity for chloride ions, which may be due to its trifluoroacetyl group. The drug has two homologues: Boc-Pyr-Cl and Boc-Pyr-Br.
Formula:C10H15NO5Purity:Min. 95%Color and Shape:PowderMolecular weight:229.23 g/mol








