CAS 53111-20-9
:(2-Methoxyphenyl)diphenylphosphine
Description:
(2-Methoxyphenyl)diphenylphosphine, with the CAS number 53111-20-9, is an organophosphorus compound characterized by the presence of a phosphorus atom bonded to two phenyl groups and one 2-methoxyphenyl group. This compound typically exhibits a white to light yellow solid appearance and is soluble in organic solvents such as dichloromethane and ether, but has limited solubility in water. The presence of the methoxy group enhances its reactivity and can influence its electronic properties, making it useful in various chemical reactions, including those involving coordination chemistry and catalysis. Its phosphine functionality allows it to act as a ligand in metal complexes, which can be utilized in organic synthesis and materials science. Additionally, (2-Methoxyphenyl)diphenylphosphine may exhibit interesting biological activities, although specific studies on its bioactivity may be limited. As with many organophosphorus compounds, proper handling and safety precautions are essential due to potential toxicity and reactivity.
Formula:C19H17OP
InChI:InChI=1S/C19H17OP/c1-20-18-14-8-9-15-19(18)21(16-10-4-2-5-11-16)17-12-6-3-7-13-17/h2-15H,1H3
InChI key:InChIKey=GBXNVYBGIFEOEM-UHFFFAOYSA-N
SMILES:P(C1=C(OC)C=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3
Synonyms:- Phosphine, (2-methoxyphenyl)diphenyl-
- Diphenyl(o-anisyl)phosphine
- (4-methoxyphenyl)(diphenyl)phosphane
- o-Anisyldiphenylphosphine
- (o-Methoxyphenyl)diphenylphosphine
- Diphenyl(2-methoxyphenyl)phosphine
- (2-methoxyphenyl)(diphenyl)phosphane
- (2-Methoxyphenyl)diphenylphosphine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(2-Methoxyphenyl)diphenylphosphine
CAS:Formula:C19H17OPPurity:95%Color and Shape:SolidMolecular weight:292.3114(2-Methoxyphenyl)diphenylphosphine
CAS:(2-Methoxyphenyl)diphenylphosphinePurity:98%Molecular weight:292.32g/molDiphenyl(2-methoxyphenyl)phosphine
CAS:<p>Diphenyl (2-methoxyphenyl)phosphine is a linear polymer that has been shown to have anticancer activity. It is synthesized by the reaction of 2-methoxyaniline with phosphorus pentachloride, and has been shown to inhibit prostate carcinoma growth in vitro. Diphenyl (2-methoxyphenyl)phosphine also inhibits bacterial growth at low concentrations, and can be used as an antibacterial agent. This compound binds to chloride ions and forms an ion pair complex. The complex then undergoes thermal decomposition, producing chloride gas, which kills bacteria by inhibiting protein synthesis. Diphenyl (2-methoxyphenyl)phosphine has also been found to have anti-inflammatory properties, which may be due to its ability to inhibit prostaglandin synthesis.</p>Formula:C19H17OPPurity:Min. 95%Molecular weight:292.31 g/mol



