CAS 53158-73-9: Delphinidin 3-sambubioside
Description:Delphinidin 3-sambubioside is a naturally occurring anthocyanin, a type of flavonoid pigment found in various plants, particularly in fruits and flowers. It is characterized by its deep blue to purple coloration, which is attributed to its ability to absorb specific wavelengths of light. This compound is known for its antioxidant properties, which can help neutralize free radicals and may contribute to various health benefits, including anti-inflammatory and anti-cancer effects. Delphinidin 3-sambubioside is soluble in water and exhibits stability under acidic conditions, making it relevant in food and beverage applications. Its structure includes a delphinidin aglycone linked to a sambubioside sugar moiety, which influences its solubility and bioactivity. This compound is often studied for its potential health benefits and its role in plant pigmentation, contributing to the visual appeal of fruits and flowers. As with many anthocyanins, its stability can be affected by factors such as pH, temperature, and light exposure, which are important considerations in both natural and processed food systems.
Formula:C26H29O16·Cl
InChI:InChI=1S/C26H28O16.ClH/c27-6-17-20(35)21(36)24(42-25-22(37)19(34)14(32)7-38-25)26(41-17)40-16-5-10-11(29)3-9(28)4-15(10)39-23(16)8-1-12(30)18(33)13(31)2-8;/h1-5,14,17,19-22,24-27,32,34-37H,6-7H2,(H4-,28,29,30,31,33);1H/t14-,17-,19+,20-,21+,22-,24-,25+,26-;/m1./s1
InChI key:InChIKey=BNDHUCYNCNEUSY-CPXTURKASA-N
SMILES:[Cl-].OC=1C=C(O)C=2C=C(OC3OC(CO)C(O)C(O)C3OC4OCC(O)C(O)C4O)C(=[O+]C2C1)C=5C=C(O)C(O)=C(O)C5
- Synonyms:
- 1-Benzopyrylium, 5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3-[(2-O-β-D-xylopyranosyl-β-D-glucopyranosyl)oxy]-, chloride
- 1-Benzopyrylium, 5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3-[(2-O-β-D-xylopyranosyl-β-D-glucopyranosyl)oxy]-, chloride (1:1)
- Delphinidin 3-O-sambubioside
- Delphinidin 3-sambubioside
