
CAS 53158-73-9
:Delphinidin 3-sambubioside
Description:
Delphinidin 3-sambubioside is a naturally occurring anthocyanin, a type of flavonoid pigment found in various plants, particularly in fruits and flowers. It is characterized by its deep blue to purple coloration, which is attributed to its ability to absorb specific wavelengths of light. This compound is known for its antioxidant properties, which can help neutralize free radicals and may contribute to various health benefits, including anti-inflammatory and anti-cancer effects. Delphinidin 3-sambubioside is soluble in water and exhibits stability under acidic conditions, making it relevant in food and beverage applications. Its structure includes a delphinidin aglycone linked to a sambubioside sugar moiety, which influences its solubility and bioactivity. This compound is often studied for its potential health benefits and its role in plant pigmentation, contributing to the visual appeal of fruits and flowers. As with many anthocyanins, its stability can be affected by factors such as pH, temperature, and light exposure, which are important considerations in both natural and processed food systems.
Formula:C26H29O16·Cl
InChI:InChI=1S/C26H28O16.ClH/c27-6-17-20(35)21(36)24(42-25-22(37)19(34)14(32)7-38-25)26(41-17)40-16-5-10-11(29)3-9(28)4-15(10)39-23(16)8-1-12(30)18(33)13(31)2-8;/h1-5,14,17,19-22,24-27,32,34-37H,6-7H2,(H4-,28,29,30,31,33);1H/t14-,17-,19+,20-,21+,22-,24-,25+,26-;/m1./s1
InChI key:InChIKey=BNDHUCYNCNEUSY-CPXTURKASA-N
SMILES:O(C=1C(=[O+]C2=C(C1)C(O)=CC(O)=C2)C3=CC(O)=C(O)C(O)=C3)[C@H]4[C@H](O[C@H]5[C@H](O)[C@@H](O)[C@H](O)CO5)[C@@H](O)[C@H](O)[C@@H](CO)O4.[Cl-]
Synonyms:- 1-Benzopyrylium, 5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3-[(2-O-β-D-xylopyranosyl-β-D-glucopyranosyl)oxy]-, chloride
- 1-Benzopyrylium, 5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3-[(2-O-β-D-xylopyranosyl-β-D-glucopyranosyl)oxy]-, chloride (1:1)
- Delphinidin 3-O-sambubioside
- Delphinidin 3-sambubioside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Delphinidin-3-O-sambubioside chloride
CAS:Delphinidin-3-O-sambubioside chloride analytical standard provided with chromatographic purity, to be used as reference material for qualitative determination.Formula:C26H29O16ClPurity:(HPLC) ≥90%Color and Shape:PowderMolecular weight:632.95Delphinidin 3-O-β-sambubioside chloride
CAS:Delphinidin 3-O-β-sambubioside chlorideFormula:C26H29ClO16Purity:≥98%Molecular weight:632.95Delphinidin 3-O-β-sambubioside chloride
CAS:Formula:C26H29ClO16Purity:98%Color and Shape:SolidMolecular weight:632.9519Dp3-Sam chloride
CAS:Dp3-Sam chloride (Delphinidin-3-sambubioside chloride) is an anthocyanin from Hibiscus acetosella with anti-inflammatory, antioxidant and anticancer activity.Formula:C26H29ClO16Color and Shape:SolidMolecular weight:632.95Delphinidin 3-sambubioside chloride
CAS:Natural glycosideFormula:C26H29O16ClPurity:≥ 95.0 % (HPLC)Color and Shape:PowderMolecular weight:632.96Delphinidin 3-sambubioside chloride
CAS:Delphinidin 3-sambubioside chloride is a natural anthocyanin, which is a type of plant-derived flavonoid pigment. It is commonly sourced from various fruits and flowers, contributing to their vivid coloration. The mode of action of this compound primarily involves its antioxidant capabilities. It stabilizes free radicals, thus reducing oxidative stress within cells.Formula:C26H29O16·ClPurity:(Hplc) Min. 90%Color and Shape:PowderMolecular weight:632.95 g/mol







