CAS 53179-78-5
:(1R-cis)-3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropane carboxylic acid
Description:
(1R-cis)-3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropane carboxylic acid is a chemical compound characterized by its unique cyclopropane structure, which includes a carboxylic acid functional group and a dibromoethenyl substituent. The presence of the cyclopropane ring imparts distinctive strain and reactivity to the molecule, influencing its chemical behavior. The (1R-cis) configuration indicates specific stereochemistry, which can affect the compound's interactions and biological activity. The dibromoethenyl group introduces significant halogenation, which can enhance the compound's reactivity and potential applications in organic synthesis or as a building block in pharmaceuticals. This compound is likely to exhibit moderate solubility in organic solvents, while its acidic nature suggests it can participate in acid-base reactions. Additionally, the presence of bromine atoms may contribute to its potential as a reagent in various chemical transformations. Overall, this compound's unique structural features and functional groups make it of interest in both synthetic chemistry and potential applications in medicinal chemistry.
Formula:C8H10Br2O2
InChI:InChI=1S/C8H10Br2O2/c1-8(2)4(3-5(9)10)6(8)7(11)12/h3-4,6H,1-2H3,(H,11,12)/t4-,6-/m0/s1
InChI key:MDIQXIJPQWLFSD-NJGYIYPDSA-N
SMILES:CC1([C@H]([C@H]1C(=O)O)C=C(Br)Br)C
Synonyms:- (1R-cis)-3-(2,2-Dibromoethenyl)-2,2-dimethylcyclopropanecarboxylic acid
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Bacisthemic Acid
CAS:Formula:C8H10Br2O2Color and Shape:White To Off-White SolidMolecular weight:297.97(1R-cis)-Decamethrinic Acid
CAS:Controlled ProductApplications A pesticide transformation product.
References Ivanyi, R., et al.: Electrophoresis, 25, 2675 (2004),Formula:C8H10Br2O2Color and Shape:NeatMolecular weight:297.97Deltamethric acid
CAS:Deltamethric acid is a crucial intermediate in the production of the insecticide Deltamethrin.Formula:C8H10Br2O2Molecular weight:297.97



